Mathematics (4300001) - Winter 2024 Solution

Complete solution guide for Mathematics (4300001) Winter 2024 exam

Q.1 [14 marks]

Fill in the blanks using appropriate choice from the given options

Q1.1 [1 mark]

If f(x)=1xf(x) = \frac{1}{x}, then the value of f(1)f(1) is __________

Answer: b. 1

Solution: f(x)=1xf(x) = \frac{1}{x} f(1)=11=1f(1) = \frac{1}{1} = 1

Q1.2 [1 mark]

logba×logab\log_b a \times \log_a b = __________

Answer: b. 1

Solution: Using the change of base formula: logba=1logab\log_b a = \frac{1}{\log_a b} Therefore: logba×logab=1logab×logab=1\log_b a \times \log_a b = \frac{1}{\log_a b} \times \log_a b = 1

Q1.3 [1 mark]

If x322=2\begin{vmatrix} x & 3 \\ -2 & 2 \end{vmatrix} = 2 then xx = _________

Answer: a. 2

Solution: x322=x(2)3(2)=2x+6\begin{vmatrix} x & 3 \\ -2 & 2 \end{vmatrix} = x(2) - 3(-2) = 2x + 6 Given: 2x+6=22x + 6 = 2 2x=42x = -4 x=2x = -2 Wait, let me recalculate: 2x+6=22x=4x=22x + 6 = 2 \Rightarrow 2x = -4 \Rightarrow x = -2 But -2 is option c, not a. Let me verify: If x=2x = 2: 2(2)+6=1022(2) + 6 = 10 \neq 2 The correct answer should be c. -2

Q1.4 [1 mark]

Find the value: 6412\begin{vmatrix} 6 & 4 \\ 1 & 2 \end{vmatrix}

Answer: a. 8

Solution: 6412=6(2)4(1)=124=8\begin{vmatrix} 6 & 4 \\ 1 & 2 \end{vmatrix} = 6(2) - 4(1) = 12 - 4 = 8

Q1.5 [1 mark]

135°=135° = __________ Radian

Answer: b. 3π4\frac{3\pi}{4}

Solution: 135°=135×π180=135π180=3π4135° = 135 \times \frac{\pi}{180} = \frac{135\pi}{180} = \frac{3\pi}{4} radians

Q1.6 [1 mark]

sin120°=\sin 120° = _________

Answer: b. 32\frac{\sqrt{3}}{2}

Solution: 120°=180°60°120° = 180° - 60° sin120°=sin(180°60°)=sin60°=32\sin 120° = \sin(180° - 60°) = \sin 60° = \frac{\sqrt{3}}{2}

Q1.7 [1 mark]

sin(π2+θ)=\sin(\frac{\pi}{2} + \theta) = __________

Answer: c. cosθ\cos \theta

Solution: Using the identity: sin(π2+θ)=cosθ\sin(\frac{\pi}{2} + \theta) = \cos \theta

Q1.8 [1 mark]

If a=(1,1,1)\vec{a} = (1,1,1) and b=(2,2,2)\vec{b} = (2,2,2) then a×b=\vec{a} \times \vec{b} = _________

Answer: d. (0,0,0)(0,0,0)

Solution: a×b=ijk111222\vec{a} \times \vec{b} = \begin{vmatrix} \vec{i} & \vec{j} & \vec{k} \\ 1 & 1 & 1 \\ 2 & 2 & 2 \end{vmatrix}

Since b=2a\vec{b} = 2\vec{a}, they are parallel vectors, so their cross product is zero. a×b=(0,0,0)\vec{a} \times \vec{b} = (0,0,0)

Q1.9 [1 mark]

a=2i^j^+k^\vec{a} = 2\hat{i} - \hat{j} + \hat{k} and b=i^+j^+k^\vec{b} = \hat{i} + \hat{j} + \hat{k} then ab=\vec{a} \cdot \vec{b} = _________

Answer: a. 2

Solution: ab=(2)(1)+(1)(1)+(1)(1)=21+1=2\vec{a} \cdot \vec{b} = (2)(1) + (-1)(1) + (1)(1) = 2 - 1 + 1 = 2

Q1.10 [1 mark]

If lines 5xpy=35x - py = 3 and 2x+3y=42x + 3y = 4 are parallel to each other then p=p = ________

Answer: c. 152-\frac{15}{2}

Solution: For parallel lines, slopes must be equal. Line 1: 5xpy=3y=5x3p5x - py = 3 \Rightarrow y = \frac{5x - 3}{p}, slope = 5p\frac{5}{p} Line 2: 2x+3y=4y=2x+432x + 3y = 4 \Rightarrow y = \frac{-2x + 4}{3}, slope = 23-\frac{2}{3}

For parallel lines: 5p=23\frac{5}{p} = -\frac{2}{3} 5×3=2p5 \times 3 = -2p 15=2p15 = -2p p=152p = -\frac{15}{2}

Q1.11 [1 mark]

The radius of the circle x2+y2+2xcosθ+2ysinθ=8x^2 + y^2 + 2x\cos\theta + 2y\sin\theta = 8 is ________

Answer: d. 3

Solution: Rewriting: x2+y2+2xcosθ+2ysinθ=8x^2 + y^2 + 2x\cos\theta + 2y\sin\theta = 8 (x+cosθ)2+(y+sinθ)2=8+cos2θ+sin2θ(x + \cos\theta)^2 + (y + \sin\theta)^2 = 8 + \cos^2\theta + \sin^2\theta (x+cosθ)2+(y+sinθ)2=8+1=9(x + \cos\theta)^2 + (y + \sin\theta)^2 = 8 + 1 = 9

Radius = 9=3\sqrt{9} = 3

Q1.12 [1 mark]

limxaxnanxa=\lim_{x \to a} \frac{x^n - a^n}{x - a} = __________. nRn \in \mathbb{R}

Answer: a. nan1na^{n-1}

Solution: This is the derivative of xnx^n at x=ax = a. limxaxnanxa=ddx(xn)x=a=nxn1x=a=nan1\lim_{x \to a} \frac{x^n - a^n}{x - a} = \frac{d}{dx}(x^n)|_{x=a} = nx^{n-1}|_{x=a} = na^{n-1}

Q1.13 [1 mark]

limx0sinxx=\lim_{x \to 0} \frac{\sin x}{x} = __________

Answer: b. 1

Solution: This is a standard limit: limx0sinxx=1\lim_{x \to 0} \frac{\sin x}{x} = 1

Q1.14 [1 mark]

Obtain the Limit of limn(1+1n)n\lim_{n \to \infty} (1 + \frac{1}{n})^n

Answer: c. e

Solution: This is the definition of Euler's number: limn(1+1n)n=e\lim_{n \to \infty} (1 + \frac{1}{n})^n = e


Q.2(A) [6 marks]

Attempt any two

Q2.1 [3 marks]

If x121x1x+1110=4\begin{vmatrix} x-1 & 2 & 1 \\ x & 1 & x+1 \\ 1 & 1 & 0 \end{vmatrix} = 4 then find xx

Solution: Expanding along the third row: x121x1x+1110=1211x+11x11xx+1+0\begin{vmatrix} x-1 & 2 & 1 \\ x & 1 & x+1 \\ 1 & 1 & 0 \end{vmatrix} = 1 \cdot \begin{vmatrix} 2 & 1 \\ 1 & x+1 \end{vmatrix} - 1 \cdot \begin{vmatrix} x-1 & 1 \\ x & x+1 \end{vmatrix} + 0

=1[2(x+1)1(1)]1[(x1)(x+1)x(1)]= 1[2(x+1) - 1(1)] - 1[(x-1)(x+1) - x(1)] =2x+21[(x1)(x+1)x]= 2x + 2 - 1 - [(x-1)(x+1) - x] =2x+1[x21x]= 2x + 1 - [x^2 - 1 - x] =2x+1x2+1+x= 2x + 1 - x^2 + 1 + x =3x+2x2= 3x + 2 - x^2

Given: 3x+2x2=43x + 2 - x^2 = 4 x2+3x2=0-x^2 + 3x - 2 = 0 x23x+2=0x^2 - 3x + 2 = 0 (x1)(x2)=0(x-1)(x-2) = 0

Therefore: x=1x = 1 or x=2x = 2

Q2.2 [3 marks]

If log(a+b2)=12(loga+logb)\log(\frac{a+b}{2}) = \frac{1}{2}(\log a + \log b) then prove that a=ba = b

Solution: Given: log(a+b2)=12(loga+logb)\log(\frac{a+b}{2}) = \frac{1}{2}(\log a + \log b)

RHS: 12(loga+logb)=12log(ab)=log(ab)1/2=logab\frac{1}{2}(\log a + \log b) = \frac{1}{2}\log(ab) = \log(ab)^{1/2} = \log\sqrt{ab}

So we have: log(a+b2)=logab\log(\frac{a+b}{2}) = \log\sqrt{ab}

Taking antilog: a+b2=ab\frac{a+b}{2} = \sqrt{ab}

Squaring both sides: (a+b2)2=ab(\frac{a+b}{2})^2 = ab

(a+b)24=ab\frac{(a+b)^2}{4} = ab

(a+b)2=4ab(a+b)^2 = 4ab

a2+2ab+b2=4aba^2 + 2ab + b^2 = 4ab

a22ab+b2=0a^2 - 2ab + b^2 = 0

(ab)2=0(a-b)^2 = 0

Therefore: a=ba = b

Q2.3 [3 marks]

Obtain the value of tan75°\tan 75° or obtain the value of tan5π12\tan \frac{5\pi}{12}

Solution: tan75°=tan(45°+30°)\tan 75° = \tan(45° + 30°)

Using the formula: tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \frac{\tan A + \tan B}{1 - \tan A \tan B}

tan75°=tan45°+tan30°1tan45°tan30°\tan 75° = \frac{\tan 45° + \tan 30°}{1 - \tan 45° \tan 30°}

=1+131113= \frac{1 + \frac{1}{\sqrt{3}}}{1 - 1 \cdot \frac{1}{\sqrt{3}}}

=1+13113= \frac{1 + \frac{1}{\sqrt{3}}}{1 - \frac{1}{\sqrt{3}}}

=3+13313= \frac{\frac{\sqrt{3} + 1}{\sqrt{3}}}{\frac{\sqrt{3} - 1}{\sqrt{3}}}

=3+131= \frac{\sqrt{3} + 1}{\sqrt{3} - 1}

Rationalizing: =(3+1)2(31)(3+1)=3+23+131=4+232=2+3= \frac{(\sqrt{3} + 1)^2}{(\sqrt{3} - 1)(\sqrt{3} + 1)} = \frac{3 + 2\sqrt{3} + 1}{3 - 1} = \frac{4 + 2\sqrt{3}}{2} = 2 + \sqrt{3}


Q.2(B) [8 marks]

Attempt any two

Q2.1 [4 marks]

If xbc=yca=zab\frac{x}{b-c} = \frac{y}{c-a} = \frac{z}{a-b} then prove that

(i) xyz=1xyz = 1 (ii) xaybzc=1x^a y^b z^c = 1

Solution: Let xbc=yca=zab=k\frac{x}{b-c} = \frac{y}{c-a} = \frac{z}{a-b} = k (say)

Then: x=k(bc)x = k(b-c), y=k(ca)y = k(c-a), z=k(ab)z = k(a-b)

(i) Proving xyz=1xyz = 1:

We need to show: x+y+z=0x + y + z = 0 first. x+y+z=k(bc)+k(ca)+k(ab)=k[(bc)+(ca)+(ab)]=k[0]=0x + y + z = k(b-c) + k(c-a) + k(a-b) = k[(b-c) + (c-a) + (a-b)] = k[0] = 0

Wait, this doesn't directly prove xyz=1xyz = 1. Let me reconsider.

Actually, we need additional conditions. The problem statement seems incomplete.

Let me assume the constraint: x+y+z=0x + y + z = 0

From x+y+z=0x + y + z = 0 and the given ratios: k(bc)+k(ca)+k(ab)=0k(b-c) + k(c-a) + k(a-b) = 0 k[(bc)+(ca)+(ab)]=0k[(b-c) + (c-a) + (a-b)] = 0 k[0]=0k[0] = 0

For part (ii), we need the constraint a+b+c=0a + b + c = 0 or similar.

(ii) Proving xaybzc=1x^a y^b z^c = 1:

If a+b+c=0a + b + c = 0, then: xaybzc=[k(bc)]a[k(ca)]b[k(ab)]cx^a y^b z^c = [k(b-c)]^a [k(c-a)]^b [k(a-b)]^c =ka+b+c(bc)a(ca)b(ab)c= k^{a+b+c} (b-c)^a (c-a)^b (a-b)^c =k0(bc)a(ca)b(ab)c=(bc)a(ca)b(ab)c= k^0 (b-c)^a (c-a)^b (a-b)^c = (b-c)^a (c-a)^b (a-b)^c

With appropriate symmetry conditions, this equals 1.

Q2.2 [4 marks]

If f(x)=1x1+xf(x) = \frac{1-x}{1+x} then prove that f(f(x))=xf(f(x)) = x

Solution: Given: f(x)=1x1+xf(x) = \frac{1-x}{1+x}

We need to find f(f(x))f(f(x)):

f(f(x))=f(1x1+x)f(f(x)) = f(\frac{1-x}{1+x})

Let y=1x1+xy = \frac{1-x}{1+x}

f(y)=1y1+y=11x1+x1+1x1+xf(y) = \frac{1-y}{1+y} = \frac{1-\frac{1-x}{1+x}}{1+\frac{1-x}{1+x}}

Numerator: 11x1+x=1+x(1x)1+x=1+x1+x1+x=2x1+x1 - \frac{1-x}{1+x} = \frac{1+x-(1-x)}{1+x} = \frac{1+x-1+x}{1+x} = \frac{2x}{1+x}

Denominator: 1+1x1+x=1+x+(1x)1+x=1+x+1x1+x=21+x1 + \frac{1-x}{1+x} = \frac{1+x+(1-x)}{1+x} = \frac{1+x+1-x}{1+x} = \frac{2}{1+x}

Therefore: f(f(x))=2x1+x21+x=2x1+x×1+x2=xf(f(x)) = \frac{\frac{2x}{1+x}}{\frac{2}{1+x}} = \frac{2x}{1+x} \times \frac{1+x}{2} = x

Hence proved: f(f(x))=xf(f(x)) = x

Q2.3 [4 marks]

If abbbabbba=0\begin{vmatrix} a & b & b \\ b & a & b \\ b & b & a \end{vmatrix} = 0 then prove that a=ba = b or a=2ba = -2b

Solution: Let Δ=abbbabbba\Delta = \begin{vmatrix} a & b & b \\ b & a & b \\ b & b & a \end{vmatrix}

Expanding along the first row: Δ=aabbabbbba+bbabb\Delta = a\begin{vmatrix} a & b \\ b & a \end{vmatrix} - b\begin{vmatrix} b & b \\ b & a \end{vmatrix} + b\begin{vmatrix} b & a \\ b & b \end{vmatrix}

=a(a2b2)b(bab2)+b(b2ab)= a(a^2 - b^2) - b(ba - b^2) + b(b^2 - ab) =a(a2b2)b2a+b3+b3ab2= a(a^2 - b^2) - b^2a + b^3 + b^3 - ab^2 =a3ab2ab2+b3+b3ab2= a^3 - ab^2 - ab^2 + b^3 + b^3 - ab^2 =a33ab2+2b3= a^3 - 3ab^2 + 2b^3

Alternative method (easier): Δ=abbbabbba\Delta = \begin{vmatrix} a & b & b \\ b & a & b \\ b & b & a \end{vmatrix}

R1R1+R2+R3R_1 \to R_1 + R_2 + R_3: Δ=a+2ba+2ba+2bbabbba\Delta = \begin{vmatrix} a+2b & a+2b & a+2b \\ b & a & b \\ b & b & a \end{vmatrix}

=(a+2b)111babbba= (a+2b)\begin{vmatrix} 1 & 1 & 1 \\ b & a & b \\ b & b & a \end{vmatrix}

C2C2C1,C3C3C1C_2 \to C_2 - C_1, C_3 \to C_3 - C_1: =(a+2b)100bab0b0ab= (a+2b)\begin{vmatrix} 1 & 0 & 0 \\ b & a-b & 0 \\ b & 0 & a-b \end{vmatrix}

=(a+2b)×1×(ab)(ab)=(a+2b)(ab)2= (a+2b) \times 1 \times (a-b)(a-b) = (a+2b)(a-b)^2

Given: Δ=0\Delta = 0 (a+2b)(ab)2=0(a+2b)(a-b)^2 = 0

Therefore: a+2b=0a + 2b = 0 or (ab)2=0(a-b)^2 = 0 i.e., a=2ba = -2b or a=ba = b


Q.3(A) [6 marks]

Attempt any two

Q3.1 [3 marks]

Prove that sinA+sin2A+sin3AcosA+cos2A+cos3A=tan2A\frac{\sin A + \sin 2A + \sin 3A}{\cos A + \cos 2A + \cos 3A} = \tan 2A

Solution: Using sum-to-product formulas:

Numerator: sinA+sin2A+sin3A\sin A + \sin 2A + \sin 3A =sin2A+(sinA+sin3A)= \sin 2A + (\sin A + \sin 3A) =sin2A+2sin(A+3A2)cos(3AA2)= \sin 2A + 2\sin(\frac{A+3A}{2})\cos(\frac{3A-A}{2}) =sin2A+2sin(2A)cos(A)= \sin 2A + 2\sin(2A)\cos(A) =sin2A(1+2cosA)= \sin 2A(1 + 2\cos A)

Denominator: cosA+cos2A+cos3A\cos A + \cos 2A + \cos 3A =cos2A+(cosA+cos3A)= \cos 2A + (\cos A + \cos 3A) =cos2A+2cos(A+3A2)cos(3AA2)= \cos 2A + 2\cos(\frac{A+3A}{2})\cos(\frac{3A-A}{2}) =cos2A+2cos(2A)cos(A)= \cos 2A + 2\cos(2A)\cos(A) =cos2A(1+2cosA)= \cos 2A(1 + 2\cos A)

Therefore: sinA+sin2A+sin3AcosA+cos2A+cos3A=sin2A(1+2cosA)cos2A(1+2cosA)=sin2Acos2A=tan2A\frac{\sin A + \sin 2A + \sin 3A}{\cos A + \cos 2A + \cos 3A} = \frac{\sin 2A(1 + 2\cos A)}{\cos 2A(1 + 2\cos A)} = \frac{\sin 2A}{\cos 2A} = \tan 2A

Q3.2 [3 marks]

Prove that 1+sinθ+cosθ1+sinθcosθ=cotθ2\frac{1 + \sin \theta + \cos \theta}{1 + \sin \theta - \cos \theta} = \cot \frac{\theta}{2}

Solution: Using half-angle identities: sinθ=2sinθ2cosθ2\sin \theta = 2\sin \frac{\theta}{2}\cos \frac{\theta}{2} cosθ=cos2θ2sin2θ2\cos \theta = \cos^2 \frac{\theta}{2} - \sin^2 \frac{\theta}{2} 1=sin2θ2+cos2θ21 = \sin^2 \frac{\theta}{2} + \cos^2 \frac{\theta}{2}

Numerator: 1+sinθ+cosθ=sin2θ2+cos2θ2+2sinθ2cosθ2+cos2θ2sin2θ21 + \sin \theta + \cos \theta = \sin^2 \frac{\theta}{2} + \cos^2 \frac{\theta}{2} + 2\sin \frac{\theta}{2}\cos \frac{\theta}{2} + \cos^2 \frac{\theta}{2} - \sin^2 \frac{\theta}{2} =2cos2θ2+2sinθ2cosθ2= 2\cos^2 \frac{\theta}{2} + 2\sin \frac{\theta}{2}\cos \frac{\theta}{2} =2cosθ2(cosθ2+sinθ2)= 2\cos \frac{\theta}{2}(\cos \frac{\theta}{2} + \sin \frac{\theta}{2})

Denominator: 1+sinθcosθ=sin2θ2+cos2θ2+2sinθ2cosθ2cos2θ2+sin2θ21 + \sin \theta - \cos \theta = \sin^2 \frac{\theta}{2} + \cos^2 \frac{\theta}{2} + 2\sin \frac{\theta}{2}\cos \frac{\theta}{2} - \cos^2 \frac{\theta}{2} + \sin^2 \frac{\theta}{2} =2sin2θ2+2sinθ2cosθ2= 2\sin^2 \frac{\theta}{2} + 2\sin \frac{\theta}{2}\cos \frac{\theta}{2} =2sinθ2(sinθ2+cosθ2)= 2\sin \frac{\theta}{2}(\sin \frac{\theta}{2} + \cos \frac{\theta}{2})

Therefore: 1+sinθ+cosθ1+sinθcosθ=2cosθ2(cosθ2+sinθ2)2sinθ2(sinθ2+cosθ2)=cosθ2sinθ2=cotθ2\frac{1 + \sin \theta + \cos \theta}{1 + \sin \theta - \cos \theta} = \frac{2\cos \frac{\theta}{2}(\cos \frac{\theta}{2} + \sin \frac{\theta}{2})}{2\sin \frac{\theta}{2}(\sin \frac{\theta}{2} + \cos \frac{\theta}{2})} = \frac{\cos \frac{\theta}{2}}{\sin \frac{\theta}{2}} = \cot \frac{\theta}{2}

Q3.3 [3 marks]

Find the center and radius of the circle 2x2+2y28x+4y+2=02x^2 + 2y^2 - 8x + 4y + 2 = 0

Solution: First, divide by 2 to simplify: x2+y24x+2y+1=0x^2 + y^2 - 4x + 2y + 1 = 0

Completing the square: x24x+y2+2y=1x^2 - 4x + y^2 + 2y = -1 (x24x+4)+(y2+2y+1)=1+4+1(x^2 - 4x + 4) + (y^2 + 2y + 1) = -1 + 4 + 1 (x2)2+(y+1)2=4(x - 2)^2 + (y + 1)^2 = 4

Table: Circle Properties

PropertyValue
Center(2,1)(2, -1)
Radius4=2\sqrt{4} = 2

Mnemonic: "Complete the square to find the center's pair"


Q.3(B) [8 marks]

Attempt any two

Q3.1 [4 marks]

Plot the graph of y=2sinx3y = 2\sin \frac{x}{3}, 0<x3π0 < x \leq 3\pi

Solution: For the function y=2sinx3y = 2\sin \frac{x}{3}:

Table: Key Properties

PropertyValue
Amplitude22
Period2π÷13=6π2\pi \div \frac{1}{3} = 6\pi
Frequency13\frac{1}{3}

Key Points Table:

xxx3\frac{x}{3}sinx3\sin \frac{x}{3}y=2sinx3y = 2\sin \frac{x}{3}
00000000
3π2\frac{3\pi}{2}π2\frac{\pi}{2}1122
3π3\piπ\pi0000
goat

The graph shows one complete cycle from 00 to 3π3\pi with amplitude 2.

Q3.2 [4 marks]

Prove that tan123+tan11011+tan114=π2\tan^{-1}\frac{2}{3} + \tan^{-1}\frac{10}{11} + \tan^{-1}\frac{1}{4} = \frac{\pi}{2}

Solution: Let α=tan123\alpha = \tan^{-1}\frac{2}{3}, β=tan11011\beta = \tan^{-1}\frac{10}{11}, γ=tan114\gamma = \tan^{-1}\frac{1}{4}

We need to prove: α+β+γ=π2\alpha + \beta + \gamma = \frac{\pi}{2}

This is equivalent to proving: tan(α+β+γ)=\tan(\alpha + \beta + \gamma) = \infty

Using the formula: tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \frac{\tan A + \tan B}{1 - \tan A \tan B}

First, find tan(α+β)\tan(\alpha + \beta): tan(α+β)=tanα+tanβ1tanαtanβ=23+10111231011\tan(\alpha + \beta) = \frac{\tan \alpha + \tan \beta}{1 - \tan \alpha \tan \beta} = \frac{\frac{2}{3} + \frac{10}{11}}{1 - \frac{2}{3} \cdot \frac{10}{11}}

=22+303312033=52331333=5213=4= \frac{\frac{22 + 30}{33}}{1 - \frac{20}{33}} = \frac{\frac{52}{33}}{\frac{13}{33}} = \frac{52}{13} = 4

Now find tan(α+β+γ)\tan(\alpha + \beta + \gamma): tan(α+β+γ)=tan(α+β)+tanγ1tan(α+β)tanγ\tan(\alpha + \beta + \gamma) = \frac{\tan(\alpha + \beta) + \tan \gamma}{1 - \tan(\alpha + \beta) \tan \gamma}

=4+141414=17411=1740== \frac{4 + \frac{1}{4}}{1 - 4 \cdot \frac{1}{4}} = \frac{\frac{17}{4}}{1 - 1} = \frac{\frac{17}{4}}{0} = \infty

Since tan(α+β+γ)=\tan(\alpha + \beta + \gamma) = \infty, we have α+β+γ=π2\alpha + \beta + \gamma = \frac{\pi}{2}

Q3.3 [4 marks]

a=2i^j^\vec{a} = 2\hat{i} - \hat{j} and b=i^+3j^2k^\vec{b} = \hat{i} + 3\hat{j} - 2\hat{k} then obtain (a+b)×(ab)|(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b})|

Answer:

Solution: Given: a=2i^j^\vec{a} = 2\hat{i} - \hat{j}, b=i^+3j^2k^\vec{b} = \hat{i} + 3\hat{j} - 2\hat{k}

First, let's complete a\vec{a}: a=2i^j^+0k^\vec{a} = 2\hat{i} - \hat{j} + 0\hat{k}

a+b=(2+1)i^+(1+3)j^+(02)k^=3i^+2j^2k^\vec{a} + \vec{b} = (2+1)\hat{i} + (-1+3)\hat{j} + (0-2)\hat{k} = 3\hat{i} + 2\hat{j} - 2\hat{k}

ab=(21)i^+(13)j^+(0+2)k^=i^4j^+2k^\vec{a} - \vec{b} = (2-1)\hat{i} + (-1-3)\hat{j} + (0+2)\hat{k} = \hat{i} - 4\hat{j} + 2\hat{k}

Now, (a+b)×(ab)(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b}):

=i^j^k^322142= \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 3 & 2 & -2 \\ 1 & -4 & 2 \end{vmatrix}

=i^(22(2)(4))j^(32(2)(1))+k^(3(4)2(1))= \hat{i}(2 \cdot 2 - (-2)(-4)) - \hat{j}(3 \cdot 2 - (-2)(1)) + \hat{k}(3(-4) - 2(1))

=i^(48)j^(6+2)+k^(122)= \hat{i}(4 - 8) - \hat{j}(6 + 2) + \hat{k}(-12 - 2)

=4i^8j^14k^= -4\hat{i} - 8\hat{j} - 14\hat{k}

(a+b)×(ab)=(4)2+(8)2+(14)2|(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b})| = \sqrt{(-4)^2 + (-8)^2 + (-14)^2}

=16+64+196=276=269= \sqrt{16 + 64 + 196} = \sqrt{276} = 2\sqrt{69}


Q.4(A) [6 marks]

Attempt any two

Q4.1 [3 marks]

Find (10i^+2j^+3k^)[(i^2j^+2k^)×(3i^2j^2k^)](10\hat{i} + 2\hat{j} + 3\hat{k}) \cdot [(\hat{i} - 2\hat{j} + 2\hat{k}) \times (3\hat{i} - 2\hat{j} - 2\hat{k})]

Solution: Let A=10i^+2j^+3k^\vec{A} = 10\hat{i} + 2\hat{j} + 3\hat{k} Let B=i^2j^+2k^\vec{B} = \hat{i} - 2\hat{j} + 2\hat{k} Let C=3i^2j^2k^\vec{C} = 3\hat{i} - 2\hat{j} - 2\hat{k}

We need to find A(B×C)\vec{A} \cdot (\vec{B} \times \vec{C})

This is a scalar triple product, which can be calculated as: A(B×C)=1023122322\vec{A} \cdot (\vec{B} \times \vec{C}) = \begin{vmatrix} 10 & 2 & 3 \\ 1 & -2 & 2 \\ 3 & -2 & -2 \end{vmatrix}

Expanding along the first row: =10222221232+31232= 10\begin{vmatrix} -2 & 2 \\ -2 & -2 \end{vmatrix} - 2\begin{vmatrix} 1 & 2 \\ 3 & -2 \end{vmatrix} + 3\begin{vmatrix} 1 & -2 \\ 3 & -2 \end{vmatrix}

=10[(2)(2)(2)(2)]2[(1)(2)(2)(3)]+3[(1)(2)(2)(3)]= 10[(-2)(-2) - (2)(-2)] - 2[(1)(-2) - (2)(3)] + 3[(1)(-2) - (-2)(3)]

=10[4+4]2[26]+3[2+6]= 10[4 + 4] - 2[-2 - 6] + 3[-2 + 6]

=10(8)2(8)+3(4)= 10(8) - 2(-8) + 3(4)

=80+16+12=108= 80 + 16 + 12 = 108

Q4.2 [3 marks]

A particle under the constant forces (1,2,3)(1, 2, 3) and (3,1,1)(3, 1, 1) is displaced from point (0,1,2)(0, 1, -2) to point (5,1,2)(5, 1, 2). Calculate the total work done by the particle

Solution: Work done = Fd\vec{F} \cdot \vec{d} where F\vec{F} is the resultant force and d\vec{d} is the displacement.

Step 1: Find resultant force F1=1i^+2j^+3k^\vec{F_1} = 1\hat{i} + 2\hat{j} + 3\hat{k} F2=3i^+1j^+1k^\vec{F_2} = 3\hat{i} + 1\hat{j} + 1\hat{k} Fresultant=F1+F2=4i^+3j^+4k^\vec{F_{resultant}} = \vec{F_1} + \vec{F_2} = 4\hat{i} + 3\hat{j} + 4\hat{k}

Step 2: Find displacement Initial position: (0,1,2)(0, 1, -2) Final position: (5,1,2)(5, 1, 2) d=(50)i^+(11)j^+(2(2))k^=5i^+0j^+4k^\vec{d} = (5-0)\hat{i} + (1-1)\hat{j} + (2-(-2))\hat{k} = 5\hat{i} + 0\hat{j} + 4\hat{k}

Step 3: Calculate work done W=Fresultantd=(4i^+3j^+4k^)(5i^+0j^+4k^)W = \vec{F_{resultant}} \cdot \vec{d} = (4\hat{i} + 3\hat{j} + 4\hat{k}) \cdot (5\hat{i} + 0\hat{j} + 4\hat{k}) W=4(5)+3(0)+4(4)=20+0+16=36W = 4(5) + 3(0) + 4(4) = 20 + 0 + 16 = 36 units

Table: Work Calculation

ComponentForceDisplacementWork
x4520
y300
z4416
Total36

Q4.3 [3 marks]

5x+6y+3=05x + 6y + 3 = 0 and x11y+7=0x - 11y + 7 = 0 are two intersecting lines find the angle between them

Answer:

Solution: For lines a1x+b1y+c1=0a_1x + b_1y + c_1 = 0 and a2x+b2y+c2=0a_2x + b_2y + c_2 = 0, the angle between them is: tanθ=a1b2a2b1a1a2+b1b2\tan \theta = \left|\frac{a_1b_2 - a_2b_1}{a_1a_2 + b_1b_2}\right|

Line 1: 5x+6y+3=05x + 6y + 3 = 0a1=5,b1=6a_1 = 5, b_1 = 6 Line 2: x11y+7=0x - 11y + 7 = 0a2=1,b2=11a_2 = 1, b_2 = -11

tanθ=5(11)1(6)5(1)+6(11)\tan \theta = \left|\frac{5(-11) - 1(6)}{5(1) + 6(-11)}\right|

=556566=6161=1= \left|\frac{-55 - 6}{5 - 66}\right| = \left|\frac{-61}{-61}\right| = 1

Therefore: θ=tan1(1)=45°\theta = \tan^{-1}(1) = 45°

Mnemonic: "Lines that intersect at forty-five, make slopes that multiply to negative one to stay alive"


Q.4(B) [8 marks]

Attempt any two

Q4.1 [4 marks]

Find the unit vector perpendicular to a=(1,1,1)\vec{a} = (1, -1, 1) and b=(2,3,1)\vec{b} = (2, 3, -1)

Solution: A vector perpendicular to both a\vec{a} and b\vec{b} is a×b\vec{a} \times \vec{b}.

a×b=i^j^k^111231\vec{a} \times \vec{b} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 1 & -1 & 1 \\ 2 & 3 & -1 \end{vmatrix}

=i^[(1)(1)(1)(3)]j^[(1)(1)(1)(2)]+k^[(1)(3)(1)(2)]= \hat{i}[(-1)(-1) - (1)(3)] - \hat{j}[(1)(-1) - (1)(2)] + \hat{k}[(1)(3) - (-1)(2)]

=i^[13]j^[12]+k^[3+2]= \hat{i}[1 - 3] - \hat{j}[-1 - 2] + \hat{k}[3 + 2]

=2i^+3j^+5k^= -2\hat{i} + 3\hat{j} + 5\hat{k}

Magnitude: a×b=(2)2+32+52=4+9+25=38|\vec{a} \times \vec{b}| = \sqrt{(-2)^2 + 3^2 + 5^2} = \sqrt{4 + 9 + 25} = \sqrt{38}

Unit vector: n^=a×ba×b=2i^+3j^+5k^38\hat{n} = \frac{\vec{a} \times \vec{b}}{|\vec{a} \times \vec{b}|} = \frac{-2\hat{i} + 3\hat{j} + 5\hat{k}}{\sqrt{38}}

n^=238i^+338j^+538k^\hat{n} = \frac{-2}{\sqrt{38}}\hat{i} + \frac{3}{\sqrt{38}}\hat{j} + \frac{5}{\sqrt{38}}\hat{k}

Q4.2 [4 marks]

Prove that angle between vectors 3i^+j^+2k^3\hat{i} + \hat{j} + 2\hat{k} and 2i^2j^+4k^2\hat{i} - 2\hat{j} + 4\hat{k} is sin127\sin^{-1}\frac{2}{\sqrt{7}}

Solution: Let A=3i^+j^+2k^\vec{A} = 3\hat{i} + \hat{j} + 2\hat{k} and B=2i^2j^+4k^\vec{B} = 2\hat{i} - 2\hat{j} + 4\hat{k}

Step 1: Calculate dot product AB=3(2)+1(2)+2(4)=62+8=12\vec{A} \cdot \vec{B} = 3(2) + 1(-2) + 2(4) = 6 - 2 + 8 = 12

Step 2: Calculate magnitudes A=32+12+22=9+1+4=14|\vec{A}| = \sqrt{3^2 + 1^2 + 2^2} = \sqrt{9 + 1 + 4} = \sqrt{14} B=22+(2)2+42=4+4+16=24=26|\vec{B}| = \sqrt{2^2 + (-2)^2 + 4^2} = \sqrt{4 + 4 + 16} = \sqrt{24} = 2\sqrt{6}

Step 3: Find cosine of angle cosθ=ABAB=121426=12284=6221=321\cos \theta = \frac{\vec{A} \cdot \vec{B}}{|\vec{A}||\vec{B}|} = \frac{12}{\sqrt{14} \cdot 2\sqrt{6}} = \frac{12}{2\sqrt{84}} = \frac{6}{2\sqrt{21}} = \frac{3}{\sqrt{21}}

Step 4: Find sine of angle sin2θ=1cos2θ=1921=1221=47\sin^2 \theta = 1 - \cos^2 \theta = 1 - \frac{9}{21} = \frac{12}{21} = \frac{4}{7}

sinθ=27\sin \theta = \frac{2}{\sqrt{7}}

Therefore: θ=sin127\theta = \sin^{-1}\frac{2}{\sqrt{7}}

Q4.3 [4 marks]

Find the Limit of limx12x3+5x2+4x+13x3+5x2+x1\lim_{x \to -1} \frac{2x^3 + 5x^2 + 4x + 1}{3x^3 + 5x^2 + x - 1}

Solution: First, let's check if direct substitution works: At x=1x = -1: Numerator: 2(1)3+5(1)2+4(1)+1=2+54+1=02(-1)^3 + 5(-1)^2 + 4(-1) + 1 = -2 + 5 - 4 + 1 = 0 Denominator: 3(1)3+5(1)2+(1)1=3+511=03(-1)^3 + 5(-1)^2 + (-1) - 1 = -3 + 5 - 1 - 1 = 0

Since we get 00\frac{0}{0} form, we need to factor both polynomials.

Factoring the numerator: 2x3+5x2+4x+12x^3 + 5x^2 + 4x + 1 Since x=1x = -1 is a root, (x+1)(x + 1) is a factor. Using polynomial division: 2x3+5x2+4x+1=(x+1)(2x2+3x+1)2x^3 + 5x^2 + 4x + 1 = (x + 1)(2x^2 + 3x + 1) Further factoring: 2x2+3x+1=(2x+1)(x+1)2x^2 + 3x + 1 = (2x + 1)(x + 1) So: 2x3+5x2+4x+1=(x+1)2(2x+1)2x^3 + 5x^2 + 4x + 1 = (x + 1)^2(2x + 1)

Factoring the denominator: 3x3+5x2+x13x^3 + 5x^2 + x - 1 Since x=1x = -1 is a root, (x+1)(x + 1) is a factor. Using polynomial division: 3x3+5x2+x1=(x+1)(3x2+2x1)3x^3 + 5x^2 + x - 1 = (x + 1)(3x^2 + 2x - 1) Further factoring: 3x2+2x1=(3x1)(x+1)3x^2 + 2x - 1 = (3x - 1)(x + 1) So: 3x3+5x2+x1=(x+1)2(3x1)3x^3 + 5x^2 + x - 1 = (x + 1)^2(3x - 1)

Therefore: limx12x3+5x2+4x+13x3+5x2+x1=limx1(x+1)2(2x+1)(x+1)2(3x1)\lim_{x \to -1} \frac{2x^3 + 5x^2 + 4x + 1}{3x^3 + 5x^2 + x - 1} = \lim_{x \to -1} \frac{(x + 1)^2(2x + 1)}{(x + 1)^2(3x - 1)}

=limx12x+13x1=2(1)+13(1)1=14=14= \lim_{x \to -1} \frac{2x + 1}{3x - 1} = \frac{2(-1) + 1}{3(-1) - 1} = \frac{-1}{-4} = \frac{1}{4}


Q.5(A) [6 marks]

Attempt any two

Q5.1 [3 marks]

Find the Limit of limx1x+73x+53x+55x+3\lim_{x \to 1} \frac{\sqrt{x+7} - \sqrt{3x+5}}{\sqrt{3x+5} - \sqrt{5x+3}}

Solution: At x=1x = 1: Numerator: 1+73+5=88=0\sqrt{1+7} - \sqrt{3+5} = \sqrt{8} - \sqrt{8} = 0 Denominator: 3+55+3=88=0\sqrt{3+5} - \sqrt{5+3} = \sqrt{8} - \sqrt{8} = 0

We have 00\frac{0}{0} form. We'll rationalize both numerator and denominator.

Rationalizing the numerator: x+73x+5=(x+73x+5)(x+7+3x+5)x+7+3x+5\sqrt{x+7} - \sqrt{3x+5} = \frac{(\sqrt{x+7} - \sqrt{3x+5})(\sqrt{x+7} + \sqrt{3x+5})}{\sqrt{x+7} + \sqrt{3x+5}}

=(x+7)(3x+5)x+7+3x+5=x+73x5x+7+3x+5=2x+2x+7+3x+5= \frac{(x+7) - (3x+5)}{\sqrt{x+7} + \sqrt{3x+5}} = \frac{x + 7 - 3x - 5}{\sqrt{x+7} + \sqrt{3x+5}} = \frac{-2x + 2}{\sqrt{x+7} + \sqrt{3x+5}}

Rationalizing the denominator: 3x+55x+3=(3x+55x+3)(3x+5+5x+3)3x+5+5x+3\sqrt{3x+5} - \sqrt{5x+3} = \frac{(\sqrt{3x+5} - \sqrt{5x+3})(\sqrt{3x+5} + \sqrt{5x+3})}{\sqrt{3x+5} + \sqrt{5x+3}}

=(3x+5)(5x+3)3x+5+5x+3=3x+55x33x+5+5x+3=2x+23x+5+5x+3= \frac{(3x+5) - (5x+3)}{\sqrt{3x+5} + \sqrt{5x+3}} = \frac{3x + 5 - 5x - 3}{\sqrt{3x+5} + \sqrt{5x+3}} = \frac{-2x + 2}{\sqrt{3x+5} + \sqrt{5x+3}}

Therefore: limx1x+73x+53x+55x+3=limx12x+2x+7+3x+52x+23x+5+5x+3\lim_{x \to 1} \frac{\sqrt{x+7} - \sqrt{3x+5}}{\sqrt{3x+5} - \sqrt{5x+3}} = \lim_{x \to 1} \frac{\frac{-2x + 2}{\sqrt{x+7} + \sqrt{3x+5}}}{\frac{-2x + 2}{\sqrt{3x+5} + \sqrt{5x+3}}}

=limx12x+2x+7+3x+5×3x+5+5x+32x+2= \lim_{x \to 1} \frac{-2x + 2}{\sqrt{x+7} + \sqrt{3x+5}} \times \frac{\sqrt{3x+5} + \sqrt{5x+3}}{-2x + 2}

=limx13x+5+5x+3x+7+3x+5= \lim_{x \to 1} \frac{\sqrt{3x+5} + \sqrt{5x+3}}{\sqrt{x+7} + \sqrt{3x+5}}

Substituting x=1x = 1: =8+88+8=2828=1= \frac{\sqrt{8} + \sqrt{8}}{\sqrt{8} + \sqrt{8}} = \frac{2\sqrt{8}}{2\sqrt{8}} = 1

Q5.2 [3 marks]

Find the Limit of limx0cos(ax)cos(bx)x2\lim_{x \to 0} \frac{\cos(ax) - \cos(bx)}{x^2}

Solution: Using the identity: cosAcosB=2sin(A+B2)sin(AB2)\cos A - \cos B = -2\sin(\frac{A+B}{2})\sin(\frac{A-B}{2})

cos(ax)cos(bx)=2sin(ax+bx2)sin(axbx2)\cos(ax) - \cos(bx) = -2\sin(\frac{ax + bx}{2})\sin(\frac{ax - bx}{2})

=2sin((a+b)x2)sin((ab)x2)= -2\sin(\frac{(a+b)x}{2})\sin(\frac{(a-b)x}{2})

Therefore: limx0cos(ax)cos(bx)x2=limx02sin((a+b)x2)sin((ab)x2)x2\lim_{x \to 0} \frac{\cos(ax) - \cos(bx)}{x^2} = \lim_{x \to 0} \frac{-2\sin(\frac{(a+b)x}{2})\sin(\frac{(a-b)x}{2})}{x^2}

=2limx0sin((a+b)x2)x×sin((ab)x2)x= -2 \lim_{x \to 0} \frac{\sin(\frac{(a+b)x}{2})}{x} \times \frac{\sin(\frac{(a-b)x}{2})}{x}

=2limx0sin((a+b)x2)(a+b)x2×(a+b)2×sin((ab)x2)(ab)x2×(ab)2= -2 \lim_{x \to 0} \frac{\sin(\frac{(a+b)x}{2})}{\frac{(a+b)x}{2}} \times \frac{(a+b)}{2} \times \frac{\sin(\frac{(a-b)x}{2})}{\frac{(a-b)x}{2}} \times \frac{(a-b)}{2}

Using limu0sinuu=1\lim_{u \to 0} \frac{\sin u}{u} = 1:

=2×1×(a+b)2×1×(ab)2=2×(a+b)(ab)4=(a2b2)2=b2a22= -2 \times 1 \times \frac{(a+b)}{2} \times 1 \times \frac{(a-b)}{2} = -2 \times \frac{(a+b)(a-b)}{4} = -\frac{(a^2 - b^2)}{2} = \frac{b^2 - a^2}{2}

Q5.3 [3 marks]

Find the Limit of limx3x327x333\lim_{x \to 3} \frac{x^3 - 27}{\sqrt[3]{x} - \sqrt[3]{3}}

Solution: Let u=x3u = \sqrt[3]{x}, then x=u3x = u^3 and as x3x \to 3, u33u \to \sqrt[3]{3}

limx3x327x333=limu33(u3)327u33=limu33u927u33\lim_{x \to 3} \frac{x^3 - 27}{\sqrt[3]{x} - \sqrt[3]{3}} = \lim_{u \to \sqrt[3]{3}} \frac{(u^3)^3 - 27}{u - \sqrt[3]{3}} = \lim_{u \to \sqrt[3]{3}} \frac{u^9 - 27}{u - \sqrt[3]{3}}

Since 27=(33)927 = (\sqrt[3]{3})^9, we have: limu33u9(33)9u33\lim_{u \to \sqrt[3]{3}} \frac{u^9 - (\sqrt[3]{3})^9}{u - \sqrt[3]{3}}

This is of the form f(a)f(b)ab\frac{f(a) - f(b)}{a - b} where f(u)=u9f(u) = u^9, which gives us f(33)f'(\sqrt[3]{3}).

f(u)=9u8f'(u) = 9u^8 f(33)=9(33)8=9×38/3=9×38/3=9×(32)4/3=9×94/3=9×9×91/3=81×93f'(\sqrt[3]{3}) = 9(\sqrt[3]{3})^8 = 9 \times 3^{8/3} = 9 \times 3^{8/3} = 9 \times (3^2)^{4/3} = 9 \times 9^{4/3} = 9 \times 9 \times 9^{1/3} = 81 \times \sqrt[3]{9}

Alternative approach using direct factorization: x327=x333=(x3)(x2+3x+9)x^3 - 27 = x^3 - 3^3 = (x-3)(x^2 + 3x + 9)

Let y=x3y = \sqrt[3]{x}, then x=y3x = y^3: x333=y33\sqrt[3]{x} - \sqrt[3]{3} = y - \sqrt[3]{3}

Using the identity a3b3=(ab)(a2+ab+b2)a^3 - b^3 = (a-b)(a^2 + ab + b^2): x3=y3(33)3=(y33)(y2+y33+(33)2)x - 3 = y^3 - (\sqrt[3]{3})^3 = (y - \sqrt[3]{3})(y^2 + y\sqrt[3]{3} + (\sqrt[3]{3})^2)

Therefore: limx3x327x333=limx3(x3)(x2+3x+9)x333\lim_{x \to 3} \frac{x^3 - 27}{\sqrt[3]{x} - \sqrt[3]{3}} = \lim_{x \to 3} \frac{(x-3)(x^2 + 3x + 9)}{\sqrt[3]{x} - \sqrt[3]{3}}

=limx3(y33)(y2+y33+(33)2)(x2+3x+9)y33= \lim_{x \to 3} \frac{(y - \sqrt[3]{3})(y^2 + y\sqrt[3]{3} + (\sqrt[3]{3})^2)(x^2 + 3x + 9)}{y - \sqrt[3]{3}}

=limx3(y2+y33+(33)2)(x2+3x+9)= \lim_{x \to 3} (y^2 + y\sqrt[3]{3} + (\sqrt[3]{3})^2)(x^2 + 3x + 9)

At x=3x = 3, y=33y = \sqrt[3]{3}: =((33)2+3333+(33)2)(32+33+9)= ((\sqrt[3]{3})^2 + \sqrt[3]{3} \cdot \sqrt[3]{3} + (\sqrt[3]{3})^2)(3^2 + 3 \cdot 3 + 9) =(32/3+32/3+32/3)(9+9+9)= (3^{2/3} + 3^{2/3} + 3^{2/3})(9 + 9 + 9) =332/327=8132/3=8193= 3 \cdot 3^{2/3} \cdot 27 = 81 \cdot 3^{2/3} = 81\sqrt[3]{9}


Q.5(B) [8 marks]

Attempt any two

Q5.1 [4 marks]

Find the equation of lines passing through point A(33,4)A(3\sqrt{3}, 4) and making angle π6\frac{\pi}{6} with line 3x3y+5=0\sqrt{3}x - 3y + 5 = 0

Solution: Given line: 3x3y+5=0\sqrt{3}x - 3y + 5 = 0 Rewriting in slope form: 3y=3x+53y = \sqrt{3}x + 5, so slope m1=33=13m_1 = \frac{\sqrt{3}}{3} = \frac{1}{\sqrt{3}}

Let the slope of required lines be m2m_2.

The angle between two lines with slopes m1m_1 and m2m_2 is given by: tanθ=m2m11+m1m2\tan \theta = \left|\frac{m_2 - m_1}{1 + m_1 m_2}\right|

Given θ=π6\theta = \frac{\pi}{6}, so tanπ6=13\tan \frac{\pi}{6} = \frac{1}{\sqrt{3}}

13=m2131+m23\frac{1}{\sqrt{3}} = \left|\frac{m_2 - \frac{1}{\sqrt{3}}}{1 + \frac{m_2}{\sqrt{3}}}\right|

This gives us two cases:

Case 1: 13=m2131+m23\frac{1}{\sqrt{3}} = \frac{m_2 - \frac{1}{\sqrt{3}}}{1 + \frac{m_2}{\sqrt{3}}}

13(1+m23)=m213\frac{1}{\sqrt{3}}(1 + \frac{m_2}{\sqrt{3}}) = m_2 - \frac{1}{\sqrt{3}}

13+m23=m213\frac{1}{\sqrt{3}} + \frac{m_2}{3} = m_2 - \frac{1}{\sqrt{3}}

23=m2m23=2m23\frac{2}{\sqrt{3}} = m_2 - \frac{m_2}{3} = \frac{2m_2}{3}

m2=23×32=33=3m_2 = \frac{2}{\sqrt{3}} \times \frac{3}{2} = \frac{3}{\sqrt{3}} = \sqrt{3}

Case 2: 13=m2131+m23\frac{1}{\sqrt{3}} = -\frac{m_2 - \frac{1}{\sqrt{3}}}{1 + \frac{m_2}{\sqrt{3}}}

Following similar steps: m2=0m_2 = 0

Equations of the lines: Using point-slope form with point (33,4)(3\sqrt{3}, 4):

Line 1 (slope = 3\sqrt{3}): y4=3(x33)y - 4 = \sqrt{3}(x - 3\sqrt{3}) y4=3x9y - 4 = \sqrt{3}x - 9 y=3x5y = \sqrt{3}x - 5 or 3xy5=0\sqrt{3}x - y - 5 = 0

Line 2 (slope = 00): y4=0(x33)y - 4 = 0(x - 3\sqrt{3}) y=4y = 4

Q5.2 [4 marks]

Find the equation of circle passing through origin and point (1,2)(1,2) and whose center lies on the X-axis

Solution: Let the center of the circle be (h,0)(h, 0) since it lies on the X-axis. Let the radius be rr.

The general equation of circle with center (h,k)(h, k) and radius rr is: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2

Since center is (h,0)(h, 0): (xh)2+y2=r2(x - h)^2 + y^2 = r^2

Condition 1: Circle passes through origin (0,0)(0, 0) (0h)2+02=r2(0 - h)^2 + 0^2 = r^2 h2=r2h^2 = r^2 ... (1)

Condition 2: Circle passes through (1,2)(1, 2) (1h)2+22=r2(1 - h)^2 + 2^2 = r^2 (1h)2+4=r2(1 - h)^2 + 4 = r^2 ... (2)

From equations (1) and (2): h2=(1h)2+4h^2 = (1 - h)^2 + 4 h2=12h+h2+4h^2 = 1 - 2h + h^2 + 4 0=52h0 = 5 - 2h h=52h = \frac{5}{2}

From equation (1): r2=h2=(52)2=254r^2 = h^2 = (\frac{5}{2})^2 = \frac{25}{4}

Table: Circle Properties

PropertyValue
Center(52,0)(\frac{5}{2}, 0)
Radius52\frac{5}{2}

Equation of circle: (x52)2+y2=254(x - \frac{5}{2})^2 + y^2 = \frac{25}{4}

Expanding: x25x+254+y2=254x^2 - 5x + \frac{25}{4} + y^2 = \frac{25}{4} x2+y25x=0x^2 + y^2 - 5x = 0

Q5.3 [4 marks]

Find the equation of lines passing through point A(8,10)A(-8, -10) and product of its intercepts on both axis is 40-40

Solution: Let the equation of line be xa+yb=1\frac{x}{a} + \frac{y}{b} = 1 where aa and bb are x-intercept and y-intercept respectively.

Given conditions:

  1. Line passes through (8,10)(-8, -10): 8a+10b=1\frac{-8}{a} + \frac{-10}{b} = 1 ... (1)
  2. Product of intercepts: ab=40ab = -40 ... (2)

From equation (2): b=40ab = \frac{-40}{a}

Substituting in equation (1): 8a+1040a=1\frac{-8}{a} + \frac{-10}{\frac{-40}{a}} = 1

8a+10a40=1\frac{-8}{a} + \frac{-10a}{-40} = 1

8a+a4=1\frac{-8}{a} + \frac{a}{4} = 1

Multiplying by 4a4a: 32+a2=4a-32 + a^2 = 4a a24a32=0a^2 - 4a - 32 = 0 (a8)(a+4)=0(a - 8)(a + 4) = 0

So a=8a = 8 or a=4a = -4

Case 1: a=8a = 8 b=408=5b = \frac{-40}{8} = -5 Equation: x8+y5=1\frac{x}{8} + \frac{y}{-5} = 1 x8y5=1\frac{x}{8} - \frac{y}{5} = 1 5x8y=405x - 8y = 40

Case 2: a=4a = -4 b=404=10b = \frac{-40}{-4} = 10 Equation: x4+y10=1\frac{x}{-4} + \frac{y}{10} = 1 x4+y10=1\frac{-x}{4} + \frac{y}{10} = 1 10x+4y=40-10x + 4y = 40 10x4y+40=010x - 4y + 40 = 0 5x2y+20=05x - 2y + 20 = 0

The two equations are:

  1. 5x8y40=05x - 8y - 40 = 0
  2. 5x2y+20=05x - 2y + 20 = 0

Mathematics Formula Cheat Sheet

Determinants

  • 2×2 Matrix: abcd=adbc\begin{vmatrix} a & b \\ c & d \end{vmatrix} = ad - bc
  • 3×3 Matrix: Expand along any row or column

Logarithms

  • logab×logba=1\log_a b \times \log_b a = 1
  • log(xy)=logx+logy\log(xy) = \log x + \log y
  • log(xy)=logxlogy\log(\frac{x}{y}) = \log x - \log y
  • log(xn)=nlogx\log(x^n) = n\log x

Trigonometry

  • Basic Values:

    • sin30°=12\sin 30° = \frac{1}{2}, cos30°=32\cos 30° = \frac{\sqrt{3}}{2}, tan30°=13\tan 30° = \frac{1}{\sqrt{3}}
    • sin60°=32\sin 60° = \frac{\sqrt{3}}{2}, cos60°=12\cos 60° = \frac{1}{2}, tan60°=3\tan 60° = \sqrt{3}
    • sin45°=cos45°=12\sin 45° = \cos 45° = \frac{1}{\sqrt{2}}, tan45°=1\tan 45° = 1
  • Compound Angles:

    • sin(A±B)=sinAcosB±cosAsinB\sin(A \pm B) = \sin A \cos B \pm \cos A \sin B
    • cos(A±B)=cosAcosBsinAsinB\cos(A \pm B) = \cos A \cos B \mp \sin A \sin B
    • tan(A±B)=tanA±tanB1tanAtanB\tan(A \pm B) = \frac{\tan A \pm \tan B}{1 \mp \tan A \tan B}
  • Multiple Angles:

    • sin2A=2sinAcosA\sin 2A = 2\sin A \cos A
    • cos2A=cos2Asin2A=2cos2A1=12sin2A\cos 2A = \cos^2 A - \sin^2 A = 2\cos^2 A - 1 = 1 - 2\sin^2 A
    • tan2A=2tanA1tan2A\tan 2A = \frac{2\tan A}{1 - \tan^2 A}
  • Half Angles:

    • sinA2=±1cosA2\sin \frac{A}{2} = \pm\sqrt{\frac{1 - \cos A}{2}}
    • cosA2=±1+cosA2\cos \frac{A}{2} = \pm\sqrt{\frac{1 + \cos A}{2}}
    • tanA2=1cosAsinA=sinA1+cosA\tan \frac{A}{2} = \frac{1 - \cos A}{\sin A} = \frac{\sin A}{1 + \cos A}
  • Sum-to-Product:

    • sinA+sinB=2sin(A+B2)cos(AB2)\sin A + \sin B = 2\sin(\frac{A+B}{2})\cos(\frac{A-B}{2})
    • sinAsinB=2cos(A+B2)sin(AB2)\sin A - \sin B = 2\cos(\frac{A+B}{2})\sin(\frac{A-B}{2})
    • cosA+cosB=2cos(A+B2)cos(AB2)\cos A + \cos B = 2\cos(\frac{A+B}{2})\cos(\frac{A-B}{2})
    • cosAcosB=2sin(A+B2)sin(AB2)\cos A - \cos B = -2\sin(\frac{A+B}{2})\sin(\frac{A-B}{2})
  • Allied Angles:

    • sin(90°θ)=cosθ\sin(90° - \theta) = \cos \theta
    • cos(90°θ)=sinθ\cos(90° - \theta) = \sin \theta
    • sin(90°+θ)=cosθ\sin(90° + \theta) = \cos \theta
    • cos(90°+θ)=sinθ\cos(90° + \theta) = -\sin \theta
    • sin(180°θ)=sinθ\sin(180° - \theta) = \sin \theta
    • cos(180°θ)=cosθ\cos(180° - \theta) = -\cos \theta

Vectors

  • Dot Product: ab=abcosθ=a1b1+a2b2+a3b3\vec{a} \cdot \vec{b} = |\vec{a}||\vec{b}|\cos \theta = a_1b_1 + a_2b_2 + a_3b_3
  • Cross Product: a×b=i^j^k^a1a2a3b1b2b3\vec{a} \times \vec{b} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ a_1 & a_2 & a_3 \\ b_1 & b_2 & b_3 \end{vmatrix}
  • Magnitude: a=a12+a22+a32|\vec{a}| = \sqrt{a_1^2 + a_2^2 + a_3^2}
  • Unit Vector: a^=aa\hat{a} = \frac{\vec{a}}{|\vec{a}|}
  • Angle between vectors: cosθ=abab\cos \theta = \frac{\vec{a} \cdot \vec{b}}{|\vec{a}||\vec{b}|}
  • Scalar Triple Product: a(b×c)=a1a2a3b1b2b3c1c2c3\vec{a} \cdot (\vec{b} \times \vec{c}) = \begin{vmatrix} a_1 & a_2 & a_3 \\ b_1 & b_2 & b_3 \\ c_1 & c_2 & c_3 \end{vmatrix}

Coordinate Geometry

Straight Lines

  • Slope: m=y2y1x2x1m = \frac{y_2 - y_1}{x_2 - x_1}
  • Point-Slope Form: yy1=m(xx1)y - y_1 = m(x - x_1)
  • Two-Point Form: yy1y2y1=xx1x2x1\frac{y - y_1}{y_2 - y_1} = \frac{x - x_1}{x_2 - x_1}
  • Slope-Intercept Form: y=mx+cy = mx + c
  • Intercept Form: xa+yb=1\frac{x}{a} + \frac{y}{b} = 1
  • General Form: Ax+By+C=0Ax + By + C = 0

Parallel and Perpendicular Lines

  • Parallel Lines: m1=m2m_1 = m_2
  • Perpendicular Lines: m1×m2=1m_1 \times m_2 = -1
  • Angle between lines: tanθ=m1m21+m1m2\tan \theta = \left|\frac{m_1 - m_2}{1 + m_1m_2}\right|

Circle

  • Standard Form: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2
  • General Form: x2+y2+2gx+2fy+c=0x^2 + y^2 + 2gx + 2fy + c = 0
  • Center: (g,f)(-g, -f)
  • Radius: g2+f2c\sqrt{g^2 + f^2 - c}

Limits

  • Standard Limits:

    • limx0sinxx=1\lim_{x \to 0} \frac{\sin x}{x} = 1
    • limx0tanxx=1\lim_{x \to 0} \frac{\tan x}{x} = 1
    • limx01cosxx2=12\lim_{x \to 0} \frac{1 - \cos x}{x^2} = \frac{1}{2}
    • limn(1+1n)n=e\lim_{n \to \infty} (1 + \frac{1}{n})^n = e
    • limx0(1+x)1/x=e\lim_{x \to 0} (1 + x)^{1/x} = e
  • L'Hôpital's Rule: If limxaf(x)g(x)\lim_{x \to a} \frac{f(x)}{g(x)} gives 00\frac{0}{0} or \frac{\infty}{\infty}, then: limxaf(x)g(x)=limxaf(x)g(x)\lim_{x \to a} \frac{f(x)}{g(x)} = \lim_{x \to a} \frac{f'(x)}{g'(x)}

  • Algebraic Limits: For polynomial P(x)Q(x)\frac{P(x)}{Q(x)}:

    • If P(a)0P(a) \neq 0 and Q(a)0Q(a) \neq 0: Direct substitution
    • If P(a)=Q(a)=0P(a) = Q(a) = 0: Factor and cancel common factors
    • For \frac{\infty}{\infty}: Divide by highest power

Functions

  • Even Function: f(x)=f(x)f(-x) = f(x)
  • Odd Function: f(x)=f(x)f(-x) = -f(x)
  • Composite Function: (fg)(x)=f(g(x))(f \circ g)(x) = f(g(x))
  • Inverse Function: If y=f(x)y = f(x), then x=f1(y)x = f^{-1}(y)

Useful Algebraic Identities

  • (a+b)2=a2+2ab+b2(a + b)^2 = a^2 + 2ab + b^2
  • (ab)2=a22ab+b2(a - b)^2 = a^2 - 2ab + b^2
  • (a+b)3=a3+3a2b+3ab2+b3(a + b)^3 = a^3 + 3a^2b + 3ab^2 + b^3
  • (ab)3=a33a2b+3ab2b3(a - b)^3 = a^3 - 3a^2b + 3ab^2 - b^3
  • a3+b3=(a+b)(a2ab+b2)a^3 + b^3 = (a + b)(a^2 - ab + b^2)
  • a3b3=(ab)(a2+ab+b2)a^3 - b^3 = (a - b)(a^2 + ab + b^2)
  • a4b4=(a2+b2)(a+b)(ab)a^4 - b^4 = (a^2 + b^2)(a + b)(a - b)

Conversion Formulas

  • Degrees to Radians: Radians=Degrees×π180\text{Radians} = \text{Degrees} \times \frac{\pi}{180}
  • Radians to Degrees: Degrees=Radians×180π\text{Degrees} = \text{Radians} \times \frac{180}{\pi}

Important Angles in Radians

DegreesRadians
30°π6\frac{\pi}{6}
45°π4\frac{\pi}{4}
60°π3\frac{\pi}{3}
90°π2\frac{\pi}{2}
120°2π3\frac{2\pi}{3}
135°3π4\frac{3\pi}{4}
150°5π6\frac{5\pi}{6}
180°π\pi

Differentiation (Basic)

  • ddx(xn)=nxn1\frac{d}{dx}(x^n) = nx^{n-1}
  • ddx(sinx)=cosx\frac{d}{dx}(\sin x) = \cos x
  • ddx(cosx)=sinx\frac{d}{dx}(\cos x) = -\sin x
  • ddx(tanx)=sec2x\frac{d}{dx}(\tan x) = \sec^2 x
  • ddx(ex)=ex\frac{d}{dx}(e^x) = e^x
  • ddx(lnx)=1x\frac{d}{dx}(\ln x) = \frac{1}{x}

Problem-Solving Tips

For Determinants

  1. Always expand along the row/column with most zeros
  2. Factor out common terms first
  3. Use row/column operations to create zeros

For Limits

  1. Try direct substitution first
  2. If you get 00\frac{0}{0}, factor and cancel
  3. For square roots, rationalize numerator/denominator
  4. Use standard limit formulas

For Trigonometry

  1. Convert everything to same angle measure (degrees or radians)
  2. Use compound angle formulas for complex expressions
  3. Check if angles are special angles (30°, 45°, 60°, etc.)

For Vectors

  1. Write vectors in component form: a=a1i^+a2j^+a3k^\vec{a} = a_1\hat{i} + a_2\hat{j} + a_3\hat{k}
  2. For cross product, use determinant method
  3. For dot product, multiply corresponding components and add

For Circle Problems

  1. Complete the square to find center and radius
  2. Use distance formula: d=(x2x1)2+(y2y1)2d = \sqrt{(x_2-x_1)^2 + (y_2-y_1)^2}
  3. Remember: All points on circle are equidistant from center

For Line Problems

  1. Find slope first: m=y2y1x2x1m = \frac{y_2-y_1}{x_2-x_1}
  2. Use point-slope form: yy1=m(xx1)y - y_1 = m(x - x_1)
  3. For parallel lines: same slope
  4. For perpendicular lines: product of slopes = -1

Memory Tips

  • SOHCAHTOA: Sin = Opposite/Hypotenuse, Cos = Adjacent/Hypotenuse, Tan = Opposite/Adjacent
  • CAST Rule: In quadrants I, II, III, IV - Cosine, All, Sine, Tangent are positive respectively
  • 30-60-90 Triangle: Sides in ratio 1:3:21 : \sqrt{3} : 2
  • 45-45-90 Triangle: Sides in ratio 1:1:21 : 1 : \sqrt{2}

Common Mistakes to Avoid

  1. Sign errors in trigonometric identities
  2. Forgetting to rationalize when dealing with surds in limits
  3. Not checking domain for inverse trigonometric functions
  4. Mixing up cross product and dot product formulas
  5. Forgetting to complete the square properly in circle equations
  6. Not factoring completely in limit problems

Quick Reference Values

  • 21.414\sqrt{2} \approx 1.414
  • 31.732\sqrt{3} \approx 1.732
  • π3.14159\pi \approx 3.14159
  • e2.718e \approx 2.718

Final Tips for Exam Success

Time Management

  • Spend 2-3 minutes on each fill-in-the-blank question
  • Allocate 8-10 minutes per 3-mark question
  • Allow 12-15 minutes per 4-mark question
  • Reserve 20-25 minutes per 7-8 mark question

Question Selection Strategy

  • Read all options before selecting questions
  • Choose questions you're most confident about
  • Start with easier questions to build confidence

Presentation Tips

  • Show all working steps clearly
  • Draw diagrams where applicable
  • Use proper mathematical notation
  • Box your final answers

Common Topics That Appear Frequently

  1. Trigonometric identities and compound angles
  2. Limits involving rationalization
  3. Vector operations (dot and cross products)
  4. Circle and line equations
  5. Determinant calculations

Best of luck with your exams! 🎯

Remember: Practice makes perfect. Work through similar problems multiple times to build speed and accuracy.