Mathematics (4300001) - Winter 2023 Solution

Complete solution guide for Mathematics (4300001) Winter 2023 exam

Q.1 [14 marks]

Fill in the blanks using appropriate choice from the given options

Q1.1 [1 mark]

sinθcosθcosθsinθ=\begin{vmatrix} \sin \theta & -\cos \theta \\ \cos \theta & \sin \theta \end{vmatrix} = _____________

Answer: c. 1

Solution: sinθcosθcosθsinθ=sinθsinθ(cosθ)cosθ\begin{vmatrix} \sin \theta & -\cos \theta \\ \cos \theta & \sin \theta \end{vmatrix} = \sin \theta \cdot \sin \theta - (-\cos \theta) \cdot \cos \theta =sin2θ+cos2θ=1= \sin^2 \theta + \cos^2 \theta = 1

Q1.2 [1 mark]

If f(x)=x31f(x) = x^3 - 1 then f(1)=f(-1) = _________

Answer: d. -2

Solution: f(x)=x31f(x) = x^3 - 1 f(1)=(1)31=11=2f(-1) = (-1)^3 - 1 = -1 - 1 = -2

Q1.3 [1 mark]

log1×log2×log3×log4=\log 1 \times \log 2 \times \log 3 \times \log 4 = ______________

Answer: a. 0

Solution: Since log1=0\log 1 = 0, we have: log1×log2×log3×log4=0×log2×log3×log4=0\log 1 \times \log 2 \times \log 3 \times \log 4 = 0 \times \log 2 \times \log 3 \times \log 4 = 0

Q1.4 [1 mark]

logxlogy=\log x - \log y = _____________

Answer: b. logxy\log \frac{x}{y}

Solution: Using logarithm property: logxlogy=logxy\log x - \log y = \log \frac{x}{y}

Q1.5 [1 mark]

Principal Period of sin(2x+7)=\sin(2x + 7) = _________

Answer: c. π\pi

Solution: For sin(ax+b)\sin(ax + b), the period is 2πa\frac{2\pi}{|a|} Here, a=2a = 2, so period = 2π2=π\frac{2\pi}{2} = \pi

Q1.6 [1 mark]

450°=450° = __________radianradian

Answer: c. 5π2\frac{5\pi}{2}

Solution: 450°=450×π180=450π180=5π2450° = 450 \times \frac{\pi}{180} = \frac{450\pi}{180} = \frac{5\pi}{2} radians

Q1.7 [1 mark]

tan1x+cot1x=\tan^{-1} x + \cot^{-1} x = _________

Answer: d. π2\frac{\pi}{2}

Solution: This is a standard identity: tan1x+cot1x=π2\tan^{-1} x + \cot^{-1} x = \frac{\pi}{2} for all x>0x > 0

Q1.8 [1 mark]

2i3j+4k=|2i - 3j + 4k| = _______

Answer: a. 29\sqrt{29}

Solution: 2i3j+4k=22+(3)2+42=4+9+16=29|2i - 3j + 4k| = \sqrt{2^2 + (-3)^2 + 4^2} = \sqrt{4 + 9 + 16} = \sqrt{29}

Q1.9 [1 mark]

For vector a×a=\vec{a} \times \vec{a} = _________

Answer: d. 0

Solution: The cross product of any vector with itself is always zero: a×a=0\vec{a} \times \vec{a} = 0

Q1.10 [1 mark]

If two lines having slopes m1m_1 and m2m_2 are perpendicular to each other then _________

Answer: c. m1m2=1m_1 \cdot m_2 = -1

Solution: For perpendicular lines, the product of their slopes equals -1.

Q1.11 [1 mark]

If x2+y2=25x^2 + y^2 = 25 then its radius ______

Answer: c. 5

Solution: Comparing with standard form x2+y2=r2x^2 + y^2 = r^2: r2=25r^2 = 25, so r=5r = 5

Q1.12 [1 mark]

limθ0sin5θtan7θ=\lim_{\theta \to 0} \frac{\sin 5\theta}{\tan 7\theta} = _________

Answer: b. 57\frac{5}{7}

Solution: limθ0sin5θtan7θ=limθ0sin5θsin7θcos7θ=limθ0sin5θcos7θsin7θ\lim_{\theta \to 0} \frac{\sin 5\theta}{\tan 7\theta} = \lim_{\theta \to 0} \frac{\sin 5\theta}{\frac{\sin 7\theta}{\cos 7\theta}} = \lim_{\theta \to 0} \frac{\sin 5\theta \cos 7\theta}{\sin 7\theta}

=limθ0sin5θ5θ7θsin7θ5θ7θcos7θ= \lim_{\theta \to 0} \frac{\sin 5\theta}{5\theta} \cdot \frac{7\theta}{\sin 7\theta} \cdot \frac{5\theta}{7\theta} \cdot \cos 7\theta

=1×1×57×1=57= 1 \times 1 \times \frac{5}{7} \times 1 = \frac{5}{7}

Q1.13 [1 mark]

limx0ex1x=\lim_{x \to 0} \frac{e^x - 1}{x} = ___________

Answer: c. 1

Solution: This is a standard limit: limx0ex1x=1\lim_{x \to 0} \frac{e^x - 1}{x} = 1

Q1.14 [1 mark]

limx1x21x1=\lim_{x \to 1} \frac{x^2 - 1}{x - 1} = _________

Answer: d. 2

Solution: limx1x21x1=limx1(x1)(x+1)x1=limx1(x+1)=1+1=2\lim_{x \to 1} \frac{x^2 - 1}{x - 1} = \lim_{x \to 1} \frac{(x-1)(x+1)}{x - 1} = \lim_{x \to 1} (x + 1) = 1 + 1 = 2


Q.2(A) [6 marks]

Attempt any two

Q2.1 [3 marks]

If f(x)=1x1+xf(x) = \frac{1-x}{1+x} then prove that (1) f(x)f(x)=1f(x) \cdot f(-x) = 1 (2) f(x)+f(1x)=0f(x) + f(\frac{1}{x}) = 0

Answer:

Solution:

Part (1): Prove f(x)f(x)=1f(x) \cdot f(-x) = 1

f(x)=1x1+xf(x) = \frac{1-x}{1+x}

f(x)=1(x)1+(x)=1+x1xf(-x) = \frac{1-(-x)}{1+(-x)} = \frac{1+x}{1-x}

f(x)f(x)=1x1+x1+x1x=(1x)(1+x)(1+x)(1x)=1f(x) \cdot f(-x) = \frac{1-x}{1+x} \cdot \frac{1+x}{1-x} = \frac{(1-x)(1+x)}{(1+x)(1-x)} = 1

Part (2): Prove f(x)+f(1x)=0f(x) + f(\frac{1}{x}) = 0

f(1x)=11x1+1x=x1xx+1x=x1x+1f(\frac{1}{x}) = \frac{1-\frac{1}{x}}{1+\frac{1}{x}} = \frac{\frac{x-1}{x}}{\frac{x+1}{x}} = \frac{x-1}{x+1}

f(x)+f(1x)=1x1+x+x1x+1=1x1+x1x1+x=0f(x) + f(\frac{1}{x}) = \frac{1-x}{1+x} + \frac{x-1}{x+1} = \frac{1-x}{1+x} - \frac{1-x}{1+x} = 0

Q2.2 [3 marks]

If x23507312=30\begin{vmatrix} x & 2 & 3 \\ 5 & 0 & 7 \\ 3 & 1 & 2 \end{vmatrix} = 30 then find the value of xx

Answer:

Solution: Expanding along the second row (which has a zero): x23507312=52312+07x231\begin{vmatrix} x & 2 & 3 \\ 5 & 0 & 7 \\ 3 & 1 & 2 \end{vmatrix} = -5 \begin{vmatrix} 2 & 3 \\ 1 & 2 \end{vmatrix} + 0 - 7 \begin{vmatrix} x & 2 \\ 3 & 1 \end{vmatrix}

=5(2×23×1)7(x×12×3)= -5(2 \times 2 - 3 \times 1) - 7(x \times 1 - 2 \times 3) =5(43)7(x6)= -5(4 - 3) - 7(x - 6) =5(1)7x+42= -5(1) - 7x + 42 =57x+42= -5 - 7x + 42 =377x= 37 - 7x

Given: 377x=3037 - 7x = 30 7x=3730=77x = 37 - 30 = 7 x=1x = 1

Q2.3 [3 marks]

Prove that tan55°=cos10°+sin10°cos10°sin10°\tan 55° = \frac{\cos 10° + \sin 10°}{\cos 10° - \sin 10°}

Answer:

Solution: We know that 55°=45°+10°55° = 45° + 10°

Using the tangent addition formula: tan(45°+10°)=tan45°+tan10°1tan45°tan10°\tan(45° + 10°) = \frac{\tan 45° + \tan 10°}{1 - \tan 45° \tan 10°}

Since tan45°=1\tan 45° = 1: tan55°=1+tan10°1tan10°\tan 55° = \frac{1 + \tan 10°}{1 - \tan 10°}

Now, tan10°=sin10°cos10°\tan 10° = \frac{\sin 10°}{\cos 10°}

tan55°=1+sin10°cos10°1sin10°cos10°=cos10°+sin10°cos10°cos10°sin10°cos10°=cos10°+sin10°cos10°sin10°\tan 55° = \frac{1 + \frac{\sin 10°}{\cos 10°}}{1 - \frac{\sin 10°}{\cos 10°}} = \frac{\frac{\cos 10° + \sin 10°}{\cos 10°}}{\frac{\cos 10° - \sin 10°}{\cos 10°}} = \frac{\cos 10° + \sin 10°}{\cos 10° - \sin 10°}


Q.2(B) [8 marks]

Attempt any two

Q2.1 [4 marks]

Prove that 1logxyxyz+1logyzxyz+1logzxxyz=2\frac{1}{\log_{xy} xyz} + \frac{1}{\log_{yz} xyz} + \frac{1}{\log_{zx} xyz} = 2

Answer:

Solution: Using the change of base formula: 1logab=logba\frac{1}{\log_a b} = \log_b a

1logxyxyz=logxyz(xy)\frac{1}{\log_{xy} xyz} = \log_{xyz} (xy) 1logyzxyz=logxyz(yz)\frac{1}{\log_{yz} xyz} = \log_{xyz} (yz) 1logzxxyz=logxyz(zx)\frac{1}{\log_{zx} xyz} = \log_{xyz} (zx)

LHS = logxyz(xy)+logxyz(yz)+logxyz(zx)\log_{xyz} (xy) + \log_{xyz} (yz) + \log_{xyz} (zx) =logxyz[(xy)(yz)(zx)]= \log_{xyz} [(xy)(yz)(zx)] =logxyz(x2y2z2)= \log_{xyz} (x^2y^2z^2) =logxyz(xyz)2= \log_{xyz} (xyz)^2 =2logxyz(xyz)= 2\log_{xyz} (xyz) =2×1=2= 2 \times 1 = 2 = RHS

Q2.2 [4 marks]

If log(a+b3)=12(loga+logb)\log(\frac{a+b}{3}) = \frac{1}{2}(\log a + \log b) then prove that a2+b2=7aba^2 + b^2 = 7ab

Answer:

Solution: Given: log(a+b3)=12(loga+logb)\log(\frac{a+b}{3}) = \frac{1}{2}(\log a + \log b)

RHS: 12(loga+logb)=12log(ab)=log(ab)1/2=logab\frac{1}{2}(\log a + \log b) = \frac{1}{2}\log(ab) = \log(ab)^{1/2} = \log\sqrt{ab}

So: log(a+b3)=logab\log(\frac{a+b}{3}) = \log\sqrt{ab}

Taking antilog: a+b3=ab\frac{a+b}{3} = \sqrt{ab}

Squaring both sides: (a+b3)2=ab(\frac{a+b}{3})^2 = ab

(a+b)29=ab\frac{(a+b)^2}{9} = ab

(a+b)2=9ab(a+b)^2 = 9ab

a2+2ab+b2=9aba^2 + 2ab + b^2 = 9ab

a2+b2=9ab2ab=7aba^2 + b^2 = 9ab - 2ab = 7ab

Q2.3 [4 marks]

If logx×log16log32=log256\log x \times \frac{\log 16}{\log 32} = \log 256 then find the value of xx

Answer:

Solution: First, let's simplify the logarithmic terms: log16=log24=4log2\log 16 = \log 2^4 = 4\log 2 log32=log25=5log2\log 32 = \log 2^5 = 5\log 2 log256=log28=8log2\log 256 = \log 2^8 = 8\log 2

log16log32=4log25log2=45\frac{\log 16}{\log 32} = \frac{4\log 2}{5\log 2} = \frac{4}{5}

Given equation becomes: logx×45=8log2\log x \times \frac{4}{5} = 8\log 2

logx=5×8log24=10log2\log x = \frac{5 \times 8\log 2}{4} = 10\log 2

logx=log210=log1024\log x = \log 2^{10} = \log 1024

Therefore: x=1024x = 1024


Q.3(A) [6 marks]

Attempt any two

Q3.1 [3 marks]

Prove that sin(π2+θ)cos(πθ)+cot(3π2θ)tan(πθ)+cosec(π2θ)sec(π+θ)=3\frac{\sin(\frac{\pi}{2}+\theta)}{\cos(\pi-\theta)} + \frac{\cot(\frac{3\pi}{2}-\theta)}{\tan(\pi-\theta)} + \frac{\cosec(\frac{\pi}{2}-\theta)}{\sec(\pi+\theta)} = -3

Answer:

Solution: Using trigonometric identities:

First term: sin(π2+θ)=cosθ\sin(\frac{\pi}{2}+\theta) = \cos\theta cos(πθ)=cosθ\cos(\pi-\theta) = -\cos\theta sin(π2+θ)cos(πθ)=cosθcosθ=1\frac{\sin(\frac{\pi}{2}+\theta)}{\cos(\pi-\theta)} = \frac{\cos\theta}{-\cos\theta} = -1

Second term: cot(3π2θ)=cot(2ππ2θ)=cot((π2+θ))=cot(π2+θ)=(tanθ)=tanθ\cot(\frac{3\pi}{2}-\theta) = \cot(2\pi - \frac{\pi}{2} - \theta) = \cot(-(\frac{\pi}{2} + \theta)) = -\cot(\frac{\pi}{2} + \theta) = -(-\tan\theta) = \tan\theta tan(πθ)=tanθ\tan(\pi-\theta) = -\tan\theta cot(3π2θ)tan(πθ)=tanθtanθ=1\frac{\cot(\frac{3\pi}{2}-\theta)}{\tan(\pi-\theta)} = \frac{\tan\theta}{-\tan\theta} = -1

Third term: cosec(π2θ)=1sin(π2θ)=1cosθ\cosec(\frac{\pi}{2}-\theta) = \frac{1}{\sin(\frac{\pi}{2}-\theta)} = \frac{1}{\cos\theta} sec(π+θ)=1cos(π+θ)=1cosθ\sec(\pi+\theta) = \frac{1}{\cos(\pi+\theta)} = \frac{1}{-\cos\theta} cosec(π2θ)sec(π+θ)=1cosθ1cosθ=cosθcosθ=1\frac{\cosec(\frac{\pi}{2}-\theta)}{\sec(\pi+\theta)} = \frac{\frac{1}{\cos\theta}}{\frac{1}{-\cos\theta}} = \frac{-\cos\theta}{\cos\theta} = -1

Therefore: LHS = (1)+(1)+(1)=3(-1) + (-1) + (-1) = -3 = RHS

Q3.2 [3 marks]

Prove that tan112+tan113=π4\tan^{-1}\frac{1}{2} + \tan^{-1}\frac{1}{3} = \frac{\pi}{4}

Answer:

Solution: Using the formula: tan1a+tan1b=tan1(a+b1ab)\tan^{-1}a + \tan^{-1}b = \tan^{-1}(\frac{a+b}{1-ab}) when ab<1ab < 1

Let a=12a = \frac{1}{2} and b=13b = \frac{1}{3}

ab=12×13=16<1ab = \frac{1}{2} \times \frac{1}{3} = \frac{1}{6} < 1

tan112+tan113=tan1(12+13112×13)\tan^{-1}\frac{1}{2} + \tan^{-1}\frac{1}{3} = \tan^{-1}(\frac{\frac{1}{2} + \frac{1}{3}}{1 - \frac{1}{2} \times \frac{1}{3}})

=tan1(3+26116)=tan1(5656)=tan1(1)=π4= \tan^{-1}(\frac{\frac{3+2}{6}}{1 - \frac{1}{6}}) = \tan^{-1}(\frac{\frac{5}{6}}{\frac{5}{6}}) = \tan^{-1}(1) = \frac{\pi}{4}

Q3.3 [3 marks]

Find the equation of the line passing through points (1,6)(1, 6) and (2,5)(-2, 5). Also find the slope of the line.

Answer:

Solution: Step 1: Find the slope m=y2y1x2x1=5621=13=13m = \frac{y_2 - y_1}{x_2 - x_1} = \frac{5 - 6}{-2 - 1} = \frac{-1}{-3} = \frac{1}{3}

Step 2: Find the equation using point-slope form Using point (1,6)(1, 6): y6=13(x1)y - 6 = \frac{1}{3}(x - 1) 3(y6)=x13(y - 6) = x - 1 3y18=x13y - 18 = x - 1 x3y+17=0x - 3y + 17 = 0

Table: Line Properties

PropertyValue
Slope13\frac{1}{3}
Equationx3y+17=0x - 3y + 17 = 0

Q.3(B) [8 marks]

Attempt any two

Q3.1 [4 marks]

Draw the graph of y=sinxy = \sin x; 0xπ0 \leq x \leq \pi

Answer:

Solution:

Table of Key Points:

xx00π6\frac{\pi}{6}π4\frac{\pi}{4}π3\frac{\pi}{3}π2\frac{\pi}{2}2π3\frac{2\pi}{3}3π4\frac{3\pi}{4}5π6\frac{5\pi}{6}π\pi
y=sinxy = \sin x0012\frac{1}{2}22\frac{\sqrt{2}}{2}32\frac{\sqrt{3}}{2}1132\frac{\sqrt{3}}{2}22\frac{\sqrt{2}}{2}12\frac{1}{2}00
goat

Properties:

  • Domain: [0,π][0, \pi]
  • Range: [0,1][0, 1]
  • Maximum: 11 at x=π2x = \frac{\pi}{2}
  • Zeros: x=0x = 0 and x=πx = \pi

Q3.2 [4 marks]

Prove that sinθ+sin2θ+sin4θ+sin5θcosθ+cos2θ+cos4θ+cos5θ=tan3θ\frac{\sin \theta + \sin 2\theta + \sin 4\theta + \sin 5\theta}{\cos \theta + \cos 2\theta + \cos 4\theta + \cos 5\theta} = \tan 3\theta

Answer:

Solution: We can group the terms strategically:

Numerator: (sinθ+sin5θ)+(sin2θ+sin4θ)(\sin \theta + \sin 5\theta) + (\sin 2\theta + \sin 4\theta)

Using sum-to-product formula: sinA+sinB=2sin(A+B2)cos(AB2)\sin A + \sin B = 2\sin(\frac{A+B}{2})\cos(\frac{A-B}{2})

sinθ+sin5θ=2sin(θ+5θ2)cos(5θθ2)=2sin(3θ)cos(2θ)\sin \theta + \sin 5\theta = 2\sin(\frac{\theta + 5\theta}{2})\cos(\frac{5\theta - \theta}{2}) = 2\sin(3\theta)\cos(2\theta)

sin2θ+sin4θ=2sin(2θ+4θ2)cos(4θ2θ2)=2sin(3θ)cos(θ)\sin 2\theta + \sin 4\theta = 2\sin(\frac{2\theta + 4\theta}{2})\cos(\frac{4\theta - 2\theta}{2}) = 2\sin(3\theta)\cos(\theta)

Numerator = 2sin(3θ)cos(2θ)+2sin(3θ)cos(θ)=2sin(3θ)[cos(2θ)+cos(θ)]2\sin(3\theta)\cos(2\theta) + 2\sin(3\theta)\cos(\theta) = 2\sin(3\theta)[\cos(2\theta) + \cos(\theta)]

Denominator: (cosθ+cos5θ)+(cos2θ+cos4θ)(\cos \theta + \cos 5\theta) + (\cos 2\theta + \cos 4\theta)

cosθ+cos5θ=2cos(θ+5θ2)cos(5θθ2)=2cos(3θ)cos(2θ)\cos \theta + \cos 5\theta = 2\cos(\frac{\theta + 5\theta}{2})\cos(\frac{5\theta - \theta}{2}) = 2\cos(3\theta)\cos(2\theta)

cos2θ+cos4θ=2cos(2θ+4θ2)cos(4θ2θ2)=2cos(3θ)cos(θ)\cos 2\theta + \cos 4\theta = 2\cos(\frac{2\theta + 4\theta}{2})\cos(\frac{4\theta - 2\theta}{2}) = 2\cos(3\theta)\cos(\theta)

Denominator = 2cos(3θ)cos(2θ)+2cos(3θ)cos(θ)=2cos(3θ)[cos(2θ)+cos(θ)]2\cos(3\theta)\cos(2\theta) + 2\cos(3\theta)\cos(\theta) = 2\cos(3\theta)[\cos(2\theta) + \cos(\theta)]

Therefore: NumeratorDenominator=2sin(3θ)[cos(2θ)+cos(θ)]2cos(3θ)[cos(2θ)+cos(θ)]=sin(3θ)cos(3θ)=tan(3θ)\frac{\text{Numerator}}{\text{Denominator}} = \frac{2\sin(3\theta)[\cos(2\theta) + \cos(\theta)]}{2\cos(3\theta)[\cos(2\theta) + \cos(\theta)]} = \frac{\sin(3\theta)}{\cos(3\theta)} = \tan(3\theta)

Q3.3 [4 marks]

The constant forces ij+ki - j + k, i+j3ki + j - 3k and 4i+5j6k4i + 5j - 6k act on a particle. Under the action of these forces, particle moves from point 3i2j+k3i - 2j + k to point i+3j4ki + 3j - 4k. Find the total work done by the forces.

Answer:

Solution: Step 1: Find resultant force Ftotal=(ij+k)+(i+j3k)+(4i+5j6k)\vec{F_{total}} = (i - j + k) + (i + j - 3k) + (4i + 5j - 6k) =(1+1+4)i+(1+1+5)j+(136)k= (1 + 1 + 4)i + (-1 + 1 + 5)j + (1 - 3 - 6)k =6i+5j8k= 6i + 5j - 8k

Step 2: Find displacement Initial position: 3i2j+k3i - 2j + k Final position: i+3j4ki + 3j - 4k d=(i+3j4k)(3i2j+k)=2i+5j5k\vec{d} = (i + 3j - 4k) - (3i - 2j + k) = -2i + 5j - 5k

Step 3: Calculate work done W=Ftotald=(6i+5j8k)(2i+5j5k)W = \vec{F_{total}} \cdot \vec{d} = (6i + 5j - 8k) \cdot (-2i + 5j - 5k) W=6(2)+5(5)+(8)(5)=12+25+40=53W = 6(-2) + 5(5) + (-8)(-5) = -12 + 25 + 40 = 53 units

Table: Work Calculation

ComponentForceDisplacementWork
x6-2-12
y5525
z-8-540
Total53

Q.4(A) [6 marks]

Attempt any two

Q4.1 [3 marks]

If a=3ij4k\vec{a} = 3i - j - 4k, b=4j2i3k\vec{b} = 4j - 2i - 3k and c=2jki\vec{c} = 2j - k - i then find 3a2b+4c|3\vec{a} - 2\vec{b} + 4\vec{c}|

Answer:

Solution: First, let's rewrite the vectors in standard form: a=3ij4k\vec{a} = 3i - j - 4k b=2i+4j3k\vec{b} = -2i + 4j - 3k c=i+2jk\vec{c} = -i + 2j - k

3a=3(3ij4k)=9i3j12k3\vec{a} = 3(3i - j - 4k) = 9i - 3j - 12k 2b=2(2i+4j3k)=4i+8j6k2\vec{b} = 2(-2i + 4j - 3k) = -4i + 8j - 6k 4c=4(i+2jk)=4i+8j4k4\vec{c} = 4(-i + 2j - k) = -4i + 8j - 4k

3a2b+4c=(9i3j12k)(4i+8j6k)+(4i+8j4k)3\vec{a} - 2\vec{b} + 4\vec{c} = (9i - 3j - 12k) - (-4i + 8j - 6k) + (-4i + 8j - 4k) =9i3j12k+4i8j+6k4i+8j4k= 9i - 3j - 12k + 4i - 8j + 6k - 4i + 8j - 4k =(9+44)i+(38+8)j+(12+64)k= (9 + 4 - 4)i + (-3 - 8 + 8)j + (-12 + 6 - 4)k =9i3j10k= 9i - 3j - 10k

3a2b+4c=92+(3)2+(10)2=81+9+100=190|3\vec{a} - 2\vec{b} + 4\vec{c}| = \sqrt{9^2 + (-3)^2 + (-10)^2} = \sqrt{81 + 9 + 100} = \sqrt{190}

Q4.2 [3 marks]

For what value of mm, the vectors 2i3j+5k2i - 3j + 5k and mi6j8kmi - 6j - 8k are perpendicular to each other?

Answer:

Solution: For two vectors to be perpendicular, their dot product must be zero.

A=2i3j+5k\vec{A} = 2i - 3j + 5k B=mi6j8k\vec{B} = mi - 6j - 8k

AB=0\vec{A} \cdot \vec{B} = 0 (2)(m)+(3)(6)+(5)(8)=0(2)(m) + (-3)(-6) + (5)(-8) = 0 2m+1840=02m + 18 - 40 = 0 2m22=02m - 22 = 0 m=11m = 11

Q4.3 [3 marks]

Find the equation of the circle having center (4,3)(4, 3) and passing through point (7,2)(7, -2)

Answer:

Solution: Step 1: Find radius r=(74)2+(23)2=32+(5)2=9+25=34r = \sqrt{(7-4)^2 + (-2-3)^2} = \sqrt{3^2 + (-5)^2} = \sqrt{9 + 25} = \sqrt{34}

Step 2: Write equation Using standard form: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2 (x4)2+(y3)2=34(x - 4)^2 + (y - 3)^2 = 34

Step 3: Expand x28x+16+y26y+9=34x^2 - 8x + 16 + y^2 - 6y + 9 = 34 x2+y28x6y+2534=0x^2 + y^2 - 8x - 6y + 25 - 34 = 0 x2+y28x6y9=0x^2 + y^2 - 8x - 6y - 9 = 0

Table: Circle Properties

PropertyValue
Center(4,3)(4, 3)
Radius34\sqrt{34}
Standard Form(x4)2+(y3)2=34(x-4)^2 + (y-3)^2 = 34
General Formx2+y28x6y9=0x^2 + y^2 - 8x - 6y - 9 = 0

Q.4(B) [8 marks]

Attempt any two

Q4.1 [4 marks]

Prove that the angle between vectors i+2ji + 2j and i+j+3ki + j + 3k is sin14655\sin^{-1}\sqrt{\frac{46}{55}}

Answer:

Solution: Let A=i+2j\vec{A} = i + 2j and B=i+j+3k\vec{B} = i + j + 3k

Step 1: Calculate dot product AB=(1)(1)+(2)(1)+(0)(3)=1+2+0=3\vec{A} \cdot \vec{B} = (1)(1) + (2)(1) + (0)(3) = 1 + 2 + 0 = 3

Step 2: Calculate magnitudes A=12+22+02=5|\vec{A}| = \sqrt{1^2 + 2^2 + 0^2} = \sqrt{5} B=12+12+32=11|\vec{B}| = \sqrt{1^2 + 1^2 + 3^2} = \sqrt{11}

Step 3: Find cosine of angle cosθ=ABAB=35×11=355\cos \theta = \frac{\vec{A} \cdot \vec{B}}{|\vec{A}||\vec{B}|} = \frac{3}{\sqrt{5} \times \sqrt{11}} = \frac{3}{\sqrt{55}}

Step 4: Find sine of angle sin2θ=1cos2θ=1955=55955=4655\sin^2 \theta = 1 - \cos^2 \theta = 1 - \frac{9}{55} = \frac{55 - 9}{55} = \frac{46}{55}

sinθ=4655\sin \theta = \sqrt{\frac{46}{55}}

Therefore: θ=sin14655\theta = \sin^{-1}\sqrt{\frac{46}{55}}

Q4.2 [4 marks]

If x=2k+3i\vec{x} = -2k + 3i and y=5i+2j4k\vec{y} = 5i + 2j - 4k then find the value of (x+y)×(xy)|(\vec{x} + \vec{y}) \times (\vec{x} - \vec{y})|

Answer:

Solution: First, let's rewrite in standard form: x=3i+0j2k\vec{x} = 3i + 0j - 2k y=5i+2j4k\vec{y} = 5i + 2j - 4k

x+y=(3+5)i+(0+2)j+(24)k=8i+2j6k\vec{x} + \vec{y} = (3 + 5)i + (0 + 2)j + (-2 - 4)k = 8i + 2j - 6k xy=(35)i+(02)j+(2+4)k=2i2j+2k\vec{x} - \vec{y} = (3 - 5)i + (0 - 2)j + (-2 + 4)k = -2i - 2j + 2k

(x+y)×(xy)=i^j^k^826222(\vec{x} + \vec{y}) \times (\vec{x} - \vec{y}) = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 8 & 2 & -6 \\ -2 & -2 & 2 \end{vmatrix}

=i^(2×2(6)×(2))j^(8×2(6)×(2))+k^(8×(2)2×(2))= \hat{i}(2 \times 2 - (-6) \times (-2)) - \hat{j}(8 \times 2 - (-6) \times (-2)) + \hat{k}(8 \times (-2) - 2 \times (-2)) =i^(412)j^(1612)+k^(16+4)= \hat{i}(4 - 12) - \hat{j}(16 - 12) + \hat{k}(-16 + 4) =8i^4j^12k^= -8\hat{i} - 4\hat{j} - 12\hat{k}

(x+y)×(xy)=(8)2+(4)2+(12)2|(\vec{x} + \vec{y}) \times (\vec{x} - \vec{y})| = \sqrt{(-8)^2 + (-4)^2 + (-12)^2} =64+16+144=224=414= \sqrt{64 + 16 + 144} = \sqrt{224} = 4\sqrt{14}

Q4.3 [4 marks]

Evaluate: limn(n2+n+1n)\lim_{n \to \infty} (\sqrt{n^2 + n + 1} - n)

Answer:

Solution: We have the indeterminate form \infty - \infty. Let's rationalize:

limn(n2+n+1n)\lim_{n \to \infty} (\sqrt{n^2 + n + 1} - n)

Multiply and divide by the conjugate: =limn(n2+n+1n)(n2+n+1+n)n2+n+1+n= \lim_{n \to \infty} \frac{(\sqrt{n^2 + n + 1} - n)(\sqrt{n^2 + n + 1} + n)}{\sqrt{n^2 + n + 1} + n}

=limn(n2+n+1)n2n2+n+1+n= \lim_{n \to \infty} \frac{(n^2 + n + 1) - n^2}{\sqrt{n^2 + n + 1} + n}

=limnn+1n2+n+1+n= \lim_{n \to \infty} \frac{n + 1}{\sqrt{n^2 + n + 1} + n}

Divide numerator and denominator by nn: =limn1+1n1+1n+1n2+1= \lim_{n \to \infty} \frac{1 + \frac{1}{n}}{\sqrt{1 + \frac{1}{n} + \frac{1}{n^2}} + 1}

=1+01+0+0+1=11+1=12= \frac{1 + 0}{\sqrt{1 + 0 + 0} + 1} = \frac{1}{1 + 1} = \frac{1}{2}


Q.5(A) [6 marks]

Attempt any two

Q5.1 [3 marks]

Evaluate: limx2x3+2x2+x+2x2+x2\lim_{x \to -2} \frac{x^3 + 2x^2 + x + 2}{x^2 + x - 2}

Answer:

Solution: Direct substitution at x=2x = -2: Numerator: (2)3+2(2)2+(2)+2=8+82+2=0(-2)^3 + 2(-2)^2 + (-2) + 2 = -8 + 8 - 2 + 2 = 0 Denominator: (2)2+(2)2=422=0(-2)^2 + (-2) - 2 = 4 - 2 - 2 = 0

We get 00\frac{0}{0} form, so we need to factor.

Factoring numerator: x3+2x2+x+2x^3 + 2x^2 + x + 2 =x2(x+2)+1(x+2)=(x+2)(x2+1)= x^2(x + 2) + 1(x + 2) = (x + 2)(x^2 + 1)

Factoring denominator: x2+x2x^2 + x - 2 =(x+2)(x1)= (x + 2)(x - 1)

limx2x3+2x2+x+2x2+x2=limx2(x+2)(x2+1)(x+2)(x1)\lim_{x \to -2} \frac{x^3 + 2x^2 + x + 2}{x^2 + x - 2} = \lim_{x \to -2} \frac{(x + 2)(x^2 + 1)}{(x + 2)(x - 1)}

=limx2x2+1x1=(2)2+121=4+13=53=53= \lim_{x \to -2} \frac{x^2 + 1}{x - 1} = \frac{(-2)^2 + 1}{-2 - 1} = \frac{4 + 1}{-3} = \frac{5}{-3} = -\frac{5}{3}

Q5.2 [3 marks]

Evaluate: limxπ21sinxcos2x\lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{\cos^2 x}

Answer:

Solution: Direct substitution at x=π2x = \frac{\pi}{2}: Numerator: 1sinπ2=11=01 - \sin \frac{\pi}{2} = 1 - 1 = 0 Denominator: cos2π2=02=0\cos^2 \frac{\pi}{2} = 0^2 = 0

We get 00\frac{0}{0} form.

Using the identity: cos2x=1sin2x\cos^2 x = 1 - \sin^2 x

limxπ21sinxcos2x=limxπ21sinx1sin2x\lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{\cos^2 x} = \lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{1 - \sin^2 x}

=limxπ21sinx(1sinx)(1+sinx)= \lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{(1 - \sin x)(1 + \sin x)}

=limxπ211+sinx= \lim_{x \to \frac{\pi}{2}} \frac{1}{1 + \sin x}

Substituting x=π2x = \frac{\pi}{2}: =11+1=12= \frac{1}{1 + 1} = \frac{1}{2}

Q5.3 [3 marks]

Evaluate: limx(1+5x)2x\lim_{x \to \infty} (1 + \frac{5}{x})^{2x}

Answer:

Solution: Let y=(1+5x)2xy = (1 + \frac{5}{x})^{2x}

Taking natural logarithm: lny=2xln(1+5x)\ln y = 2x \ln(1 + \frac{5}{x})

limxlny=limx2xln(1+5x)\lim_{x \to \infty} \ln y = \lim_{x \to \infty} 2x \ln(1 + \frac{5}{x})

Let t=5xt = \frac{5}{x}, then as xx \to \infty, t0t \to 0 and x=5tx = \frac{5}{t}

=limt025tln(1+t)=limt010ln(1+t)t= \lim_{t \to 0} 2 \cdot \frac{5}{t} \ln(1 + t) = \lim_{t \to 0} 10 \cdot \frac{\ln(1 + t)}{t}

Using the standard limit limt0ln(1+t)t=1\lim_{t \to 0} \frac{\ln(1 + t)}{t} = 1:

=10×1=10= 10 \times 1 = 10

Therefore: limxy=e10\lim_{x \to \infty} y = e^{10}


Q.5(B) [8 marks]

Attempt any two

Q5.1 [4 marks]

Find the equation of the line passing through point (2,4)(2, 4) and perpendicular to line 5x7y+11=05x - 7y + 11 = 0

Answer:

Solution: Step 1: Find slope of given line 5x7y+11=05x - 7y + 11 = 0 7y=5x+117y = 5x + 11 y=57x+117y = \frac{5}{7}x + \frac{11}{7} Slope of given line = 57\frac{5}{7}

Step 2: Find slope of perpendicular line For perpendicular lines: m1×m2=1m_1 \times m_2 = -1 57×m2=1\frac{5}{7} \times m_2 = -1 m2=75m_2 = -\frac{7}{5}

Step 3: Use point-slope form yy1=m(xx1)y - y_1 = m(x - x_1) y4=75(x2)y - 4 = -\frac{7}{5}(x - 2) y4=75x+145y - 4 = -\frac{7}{5}x + \frac{14}{5} y=75x+145+4y = -\frac{7}{5}x + \frac{14}{5} + 4 y=75x+14+205y = -\frac{7}{5}x + \frac{14 + 20}{5} y=75x+345y = -\frac{7}{5}x + \frac{34}{5}

Multiplying by 5: 5y=7x+345y = -7x + 34 7x+5y34=07x + 5y - 34 = 0

Q5.2 [4 marks]

If the equation of circle is 2x2+2y2+4x8y6=02x^2 + 2y^2 + 4x - 8y - 6 = 0 then find its center and radius

Answer:

Solution: Step 1: Simplify by dividing by 2 x2+y2+2x4y3=0x^2 + y^2 + 2x - 4y - 3 = 0

Step 2: Complete the square (x2+2x)+(y24y)=3(x^2 + 2x) + (y^2 - 4y) = 3 (x2+2x+1)+(y24y+4)=3+1+4(x^2 + 2x + 1) + (y^2 - 4y + 4) = 3 + 1 + 4 (x+1)2+(y2)2=8(x + 1)^2 + (y - 2)^2 = 8

Table: Circle Properties

PropertyValue
Center(1,2)(-1, 2)
Radius8=22\sqrt{8} = 2\sqrt{2}

Q5.3 [4 marks]

Find the equation of tangent and normal of circle x2+y22x+4y20=0x^2 + y^2 - 2x + 4y - 20 = 0 at point (2,2)(-2, 2)

Answer:

Solution: Step 1: Find center of circle x2+y22x+4y20=0x^2 + y^2 - 2x + 4y - 20 = 0 Completing the square: (x22x+1)+(y2+4y+4)=20+1+4(x^2 - 2x + 1) + (y^2 + 4y + 4) = 20 + 1 + 4 (x1)2+(y+2)2=25(x - 1)^2 + (y + 2)^2 = 25

Center: (1,2)(1, -2), Radius: 55

Step 2: Find slope of radius to point (2,2)(-2, 2) mradius=2(2)21=43=43m_{radius} = \frac{2 - (-2)}{-2 - 1} = \frac{4}{-3} = -\frac{4}{3}

Step 3: Find slope of tangent Tangent is perpendicular to radius: mtangent=1mradius=143=34m_{tangent} = -\frac{1}{m_{radius}} = -\frac{1}{-\frac{4}{3}} = \frac{3}{4}

Step 4: Equation of tangent Using point-slope form at (2,2)(-2, 2): y2=34(x(2))y - 2 = \frac{3}{4}(x - (-2)) y2=34(x+2)y - 2 = \frac{3}{4}(x + 2) 4(y2)=3(x+2)4(y - 2) = 3(x + 2) 4y8=3x+64y - 8 = 3x + 6 3x4y+14=03x - 4y + 14 = 0

Step 5: Equation of normal Normal has slope mradius=43m_{radius} = -\frac{4}{3}: y2=43(x+2)y - 2 = -\frac{4}{3}(x + 2) 3(y2)=4(x+2)3(y - 2) = -4(x + 2) 3y6=4x83y - 6 = -4x - 8 4x+3y+2=04x + 3y + 2 = 0

Table: Line Equations

LineEquation
Tangent3x4y+14=03x - 4y + 14 = 0
Normal4x+3y+2=04x + 3y + 2 = 0

Mathematics Formula Cheat Sheet for Winter Exams

Determinants

  • 2×2 Matrix: abcd=adbc\begin{vmatrix} a & b \\ c & d \end{vmatrix} = ad - bc
  • 3×3 Matrix: Expand along row/column with most zeros
  • Properties: A=0|A| = 0 if any row/column is zero

Functions

  • Composition: (fg)(x)=f(g(x))(f \circ g)(x) = f(g(x))
  • Even function: f(x)=f(x)f(-x) = f(x)
  • Odd function: f(x)=f(x)f(-x) = -f(x)

Logarithms

  • Basic properties:
    • logaa=1\log_a a = 1
    • log1=0\log 1 = 0
    • logxlogy=logxy\log x - \log y = \log \frac{x}{y}
    • logx+logy=log(xy)\log x + \log y = \log(xy)
  • Change of base: 1logab=logba\frac{1}{\log_a b} = \log_b a

Trigonometry

Periods

  • sin(ax+b)\sin(ax + b) has period 2πa\frac{2\pi}{|a|}
  • cos(ax+b)\cos(ax + b) has period 2πa\frac{2\pi}{|a|}
  • tan(ax+b)\tan(ax + b) has period πa\frac{\pi}{|a|}

Angle Conversions

  • Degrees to radians: radians=degrees×π180\text{radians} = \text{degrees} \times \frac{\pi}{180}

Inverse Trigonometric Identities

  • tan1x+cot1x=π2\tan^{-1} x + \cot^{-1} x = \frac{\pi}{2}
  • sin1x+cos1x=π2\sin^{-1} x + \cos^{-1} x = \frac{\pi}{2}
  • tan1a+tan1b=tan1(a+b1ab)\tan^{-1} a + \tan^{-1} b = \tan^{-1}(\frac{a+b}{1-ab}) when ab<1ab < 1

Allied Angles

  • sin(π2+θ)=cosθ\sin(\frac{\pi}{2} + \theta) = \cos \theta
  • cos(πθ)=cosθ\cos(\pi - \theta) = -\cos \theta
  • tan(πθ)=tanθ\tan(\pi - \theta) = -\tan \theta
  • cot(3π2θ)=tanθ\cot(\frac{3\pi}{2} - \theta) = \tan \theta

Sum-to-Product Formulas

  • sinA+sinB=2sin(A+B2)cos(AB2)\sin A + \sin B = 2\sin(\frac{A+B}{2})\cos(\frac{A-B}{2})
  • cosA+cosB=2cos(A+B2)cos(AB2)\cos A + \cos B = 2\cos(\frac{A+B}{2})\cos(\frac{A-B}{2})

Vectors

  • Magnitude: a=a12+a22+a32|\vec{a}| = \sqrt{a_1^2 + a_2^2 + a_3^2}
  • Dot Product: ab=a1b1+a2b2+a3b3\vec{a} \cdot \vec{b} = a_1b_1 + a_2b_2 + a_3b_3
  • Cross Product: a×b=i^j^k^a1a2a3b1b2b3\vec{a} \times \vec{b} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ a_1 & a_2 & a_3 \\ b_1 & b_2 & b_3 \end{vmatrix}
  • Properties:
    • a×a=0\vec{a} \times \vec{a} = 0
    • ab\vec{a} \perp \vec{b} iff ab=0\vec{a} \cdot \vec{b} = 0
  • Work done: W=FdW = \vec{F} \cdot \vec{d}

Coordinate Geometry

Lines

  • Slope: m=y2y1x2x1m = \frac{y_2 - y_1}{x_2 - x_1}
  • Two-point form: yy1y2y1=xx1x2x1\frac{y - y_1}{y_2 - y_1} = \frac{x - x_1}{x_2 - x_1}
  • Perpendicular lines: m1×m2=1m_1 \times m_2 = -1
  • Point-slope form: yy1=m(xx1)y - y_1 = m(x - x_1)

Circles

  • Standard form: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2
  • General form: x2+y2+2gx+2fy+c=0x^2 + y^2 + 2gx + 2fy + c = 0
  • Center: (g,f)(-g, -f), Radius: g2+f2c\sqrt{g^2 + f^2 - c}
  • Tangent at point (x1,y1)(x_1, y_1): xx1+yy1+g(x+x1)+f(y+y1)+c=0xx_1 + yy_1 + g(x + x_1) + f(y + y_1) + c = 0

Limits

  • Standard limits:

    • limθ0sinθθ=1\lim_{\theta \to 0} \frac{\sin \theta}{\theta} = 1
    • limx0ex1x=1\lim_{x \to 0} \frac{e^x - 1}{x} = 1
    • limxaxnanxa=nan1\lim_{x \to a} \frac{x^n - a^n}{x - a} = na^{n-1}
    • limx(1+ax)x=ea\lim_{x \to \infty} (1 + \frac{a}{x})^x = e^a
  • Rationalization: For expressions like AB\sqrt{A} - \sqrt{B}, multiply by A+BA+B\frac{\sqrt{A} + \sqrt{B}}{\sqrt{A} + \sqrt{B}}

Problem-Solving Strategies

For Function Problems

  1. Check domain restrictions
  2. Use algebraic manipulation for compositions
  3. Verify results by substitution

For Logarithmic Proofs

  1. Use change of base formula strategically
  2. Convert complex expressions to simpler forms
  3. Apply logarithm properties systematically

For Trigonometric Identities

  1. Look for sum-to-product opportunities
  2. Use allied angle formulas
  3. Factor expressions when possible

For Vector Problems

  1. Write vectors in component form
  2. Use properties of dot and cross products
  3. Check perpendicularity using dot product

For Limit Problems

  1. Try direct substitution first
  2. Factor and cancel for 00\frac{0}{0} forms
  3. Use rationalization for radical expressions
  4. Apply standard limit formulas

For Circle Problems

  1. Complete the square to find center and radius
  2. Use slope relationships for tangent and normal
  3. Remember tangent is perpendicular to radius

Common Mistakes to Avoid

  1. Sign errors in determinant calculations
  2. Forgetting domain restrictions in logarithmic functions
  3. Angle measure confusion (degrees vs radians)
  4. Not simplifying trigonometric expressions fully
  5. Calculation errors in vector operations
  6. Incomplete factorization in limit problems

Exam Success Tips

  • Show all working steps clearly
  • Verify answers when possible
  • Use proper mathematical notation
  • Draw diagrams for geometry problems
  • Manage time effectively across all questions

Best of luck with your Winter 2023 Mathematics exam! 🎯