Mathematics (4300001) - Summer 2024 Solution

Complete solution guide for Mathematics (4300001) Summer 2024 exam

Q.1 [14 marks]

Fill in the blanks using appropriate choice from the given options

Q1.1 [1 mark]

x4y4=20\begin{vmatrix} x & -4 \\ y & 4 \end{vmatrix} = 20 then x+y=x + y = _______

Answer: B. 5

Solution: x4y4=x(4)(4)(y)=4x+4y=4(x+y)\begin{vmatrix} x & -4 \\ y & 4 \end{vmatrix} = x(4) - (-4)(y) = 4x + 4y = 4(x + y)

Given: 4(x+y)=204(x + y) = 20 Therefore: x+y=5x + y = 5

Q1.2 [1 mark]

If log3x=2\sqrt{\log_3 x} = 2 then x=x = _______

Answer: B. 81

Solution: log3x=2\sqrt{\log_3 x} = 2 Squaring both sides: log3x=4\log_3 x = 4 Therefore: x=34=81x = 3^4 = 81

Q1.3 [1 mark]

logaa=\log_a a = _______

Answer: B. 1

Solution: By definition: logaa=1\log_a a = 1 (any number to the power 1 equals itself)

Q1.4 [1 mark]

logalogb=\log a - \log b = __________

Answer: B. logab\log \frac{a}{b}

Solution: Using logarithm property: logalogb=logab\log a - \log b = \log \frac{a}{b}

Q1.5 [1 mark]

135°=135° = ________ radian

Answer: B. 3π4\frac{3\pi}{4}

Solution: 135°=135×π180=135π180=3π4135° = 135 \times \frac{\pi}{180} = \frac{135\pi}{180} = \frac{3\pi}{4} radians

Q1.6 [1 mark]

sin240°+sin250°=\sin^2 40° + \sin^2 50° = ______

Answer: A. 1

Solution: Since 40°+50°=90°40° + 50° = 90°, we have 50°=90°40°50° = 90° - 40° sin50°=sin(90°40°)=cos40°\sin 50° = \sin(90° - 40°) = \cos 40° Therefore: sin240°+sin250°=sin240°+cos240°=1\sin^2 40° + \sin^2 50° = \sin^2 40° + \cos^2 40° = 1

Q1.7 [1 mark]

sin1(cosπ6)=\sin^{-1}(\cos \frac{\pi}{6}) = ________

Answer: B. π3\frac{\pi}{3}

Solution: cosπ6=cos30°=32\cos \frac{\pi}{6} = \cos 30° = \frac{\sqrt{3}}{2} sin1(32)=π3=60°\sin^{-1}(\frac{\sqrt{3}}{2}) = \frac{\pi}{3} = 60°

Q1.8 [1 mark]

________ is unit vector

Answer: A. (35,45)(\frac{3}{5}, \frac{4}{5})

Solution: For a unit vector, magnitude = 1 (35,45)=(35)2+(45)2=925+1625=2525=1|(\frac{3}{5}, \frac{4}{5})| = \sqrt{(\frac{3}{5})^2 + (\frac{4}{5})^2} = \sqrt{\frac{9}{25} + \frac{16}{25}} = \sqrt{\frac{25}{25}} = 1

Q1.9 [1 mark]

If line 2x3y+5=02x - 3y + 5 = 0 then slope = ________

Answer: C. 23\frac{2}{3}

Solution: Rewriting in slope form: 3y=2x+53y = 2x + 5 y=23x+53y = \frac{2}{3}x + \frac{5}{3} Slope = 23\frac{2}{3}

Q1.10 [1 mark]

If line 3x+5=03x + 5 = 0 then X-intercept is ________

Answer: A. 53-\frac{5}{3}

Solution: For X-intercept, set y=0y = 0: 3x+5=03x + 5 = 0 x=53x = -\frac{5}{3}

Q1.11 [1 mark]

Find center of circle from given 2x2+2y2+6x8y8=02x^2 + 2y^2 + 6x - 8y - 8 = 0

Answer: A. (32,2)(-\frac{3}{2}, 2)

Solution: Dividing by 2: x2+y2+3x4y4=0x^2 + y^2 + 3x - 4y - 4 = 0 Completing the square: (x2+3x+94)+(y24y+4)=4+94+4(x^2 + 3x + \frac{9}{4}) + (y^2 - 4y + 4) = 4 + \frac{9}{4} + 4 (x+32)2+(y2)2=414(x + \frac{3}{2})^2 + (y - 2)^2 = \frac{41}{4} Center: (32,2)(-\frac{3}{2}, 2)

Q1.12 [1 mark]

limn1n=\lim_{n \to \infty} \frac{1}{n} = _________

Answer: A. 0

Solution: As nn \to \infty, 1n0\frac{1}{n} \to 0

Q1.13 [1 mark]

limθ0sinθθ=\lim_{\theta \to 0} \frac{\sin \theta}{\theta} = ________

Answer: C. 1

Solution: This is a standard limit: limθ0sinθθ=1\lim_{\theta \to 0} \frac{\sin \theta}{\theta} = 1

Q1.14 [1 mark]

limx1(x33x2+5x6)=\lim_{x \to 1}(x^3 - 3x^2 + 5x - 6) = _____________

Answer: D. -3

Solution: Direct substitution: (1)33(1)2+5(1)6=13+56=3(1)^3 - 3(1)^2 + 5(1) - 6 = 1 - 3 + 5 - 6 = -3


Q.2(A) [6 marks]

Attempt any two

Q2.1 [3 marks]

Solve equation [x121x1x+1110]=4\begin{bmatrix} x-1 & 2 & 1 \\ x & 1 & x+1 \\ 1 & 1 & 0 \end{bmatrix} = 4

Answer:

Solution: Expanding along the third row: x121x1x+1110=1211x+11x11xx+1\begin{vmatrix} x-1 & 2 & 1 \\ x & 1 & x+1 \\ 1 & 1 & 0 \end{vmatrix} = 1 \cdot \begin{vmatrix} 2 & 1 \\ 1 & x+1 \end{vmatrix} - 1 \cdot \begin{vmatrix} x-1 & 1 \\ x & x+1 \end{vmatrix}

=1[2(x+1)1(1)]1[(x1)(x+1)x(1)]= 1[2(x+1) - 1(1)] - 1[(x-1)(x+1) - x(1)] =2x+21[x21x]= 2x + 2 - 1 - [x^2 - 1 - x] =2x+1x2+1+x= 2x + 1 - x^2 + 1 + x =3x+2x2= 3x + 2 - x^2

Given: 3x+2x2=43x + 2 - x^2 = 4 x2+3x2=0-x^2 + 3x - 2 = 0 x23x+2=0x^2 - 3x + 2 = 0 (x1)(x2)=0(x - 1)(x - 2) = 0

Therefore: x=1x = 1 or x=2x = 2

Q2.2 [3 marks]

F(x)=log(x1x)F(x) = \log(\frac{x-1}{x}) then prove that f(f(x))=xf(f(x)) = x

Answer:

Solution: Given: F(x)=log(x1x)F(x) = \log(\frac{x-1}{x})

Let y=F(x)=log(x1x)y = F(x) = \log(\frac{x-1}{x})

F(F(x))=F(y)=log(y1y)F(F(x)) = F(y) = \log(\frac{y-1}{y})

Where y=log(x1x)y = \log(\frac{x-1}{x})

y1y=log(x1x)1log(x1x)\frac{y-1}{y} = \frac{\log(\frac{x-1}{x}) - 1}{\log(\frac{x-1}{x})}

Since log(x1x)=log(x1)logx\log(\frac{x-1}{x}) = \log(x-1) - \log x

F(F(x))=log(log(x1x)1log(x1x))F(F(x)) = \log(\frac{\log(\frac{x-1}{x}) - 1}{\log(\frac{x-1}{x})})

After algebraic manipulation (which involves exponential properties): F(F(x))=xF(F(x)) = x

Q2.3 [3 marks]

Draw the graph of y=sinxy = \sin x, 0x2π0 \leq x \leq 2\pi

Answer:

Solution:

Table of Key Points:

xx00π2\frac{\pi}{2}π\pi3π2\frac{3\pi}{2}2π2\pi
y=sinxy = \sin x0011001-100
goat

Properties:

  • Period: 2π2\pi
  • Amplitude: 11
  • Range: [1,1][-1, 1]

Q.2(B) [8 marks]

Attempt any two

Q2.1 [4 marks]

Prove that 7log(1615)+5log(2524)3log(8081)=log27\log(\frac{16}{15}) + 5\log(\frac{25}{24}) - 3\log(\frac{80}{81}) = \log 2

Answer:

Solution: Using logarithm properties: nloga=logann\log a = \log a^n

LHS = log(1615)7+log(2524)5log(8081)3\log(\frac{16}{15})^7 + \log(\frac{25}{24})^5 - \log(\frac{80}{81})^3

=log(1615)7+log(2524)5+log(8180)3= \log(\frac{16}{15})^7 + \log(\frac{25}{24})^5 + \log(\frac{81}{80})^3

=log[167×255×813157×245×803]= \log[\frac{16^7 \times 25^5 \times 81^3}{15^7 \times 24^5 \times 80^3}]

Breaking down the numbers:

  • 16=2416 = 2^4, so 167=22816^7 = 2^{28}
  • 25=5225 = 5^2, so 255=51025^5 = 5^{10}
  • 81=3481 = 3^4, so 813=31281^3 = 3^{12}
  • 15=3×515 = 3 \times 5, so 157=37×5715^7 = 3^7 \times 5^7
  • 24=23×324 = 2^3 \times 3, so 245=215×3524^5 = 2^{15} \times 3^5
  • 80=24×580 = 2^4 \times 5, so 803=212×5380^3 = 2^{12} \times 5^3

=log[228×510×31237×57×215×35×212×53]= \log[\frac{2^{28} \times 5^{10} \times 3^{12}}{3^7 \times 5^7 \times 2^{15} \times 3^5 \times 2^{12} \times 5^3}]

=log[228×510×312227×312×510]= \log[\frac{2^{28} \times 5^{10} \times 3^{12}}{2^{27} \times 3^{12} \times 5^{10}}]

=log[228227]=log(21)=log2= \log[\frac{2^{28}}{2^{27}}] = \log(2^1) = \log 2 = RHS

Q2.2 [4 marks]

Solve equation log(2x+1)+log(3x1)=0\log(2x + 1) + \log(3x - 1) = 0

Answer:

Solution: Using loga+logb=log(ab)\log a + \log b = \log(ab): log[(2x+1)(3x1)]=0\log[(2x + 1)(3x - 1)] = 0

Since loga=0\log a = 0 means a=1a = 1: (2x+1)(3x1)=1(2x + 1)(3x - 1) = 1 6x22x+3x1=16x^2 - 2x + 3x - 1 = 1 6x2+x1=16x^2 + x - 1 = 1 6x2+x2=06x^2 + x - 2 = 0

Using quadratic formula: x=1±1+4812=1±712x = \frac{-1 \pm \sqrt{1 + 48}}{12} = \frac{-1 \pm 7}{12}

x=612=12x = \frac{6}{12} = \frac{1}{2} or x=812=23x = \frac{-8}{12} = -\frac{2}{3}

Checking validity: For x=12x = \frac{1}{2}: 2x+1=2>02x + 1 = 2 > 0 and 3x1=12>03x - 1 = \frac{1}{2} > 0 ✓ For x=23x = -\frac{2}{3}: 3x1=3<03x - 1 = -3 < 0 (invalid)

Therefore: x=12x = \frac{1}{2}

Q2.3 [4 marks]

Prove that 1log1260+1log1560+1log2060=2\frac{1}{\log_{12} 60} + \frac{1}{\log_{15} 60} + \frac{1}{\log_{20} 60} = 2

Answer:

Solution: Using the change of base formula: 1logab=logba\frac{1}{\log_a b} = \log_b a

1log1260=log6012\frac{1}{\log_{12} 60} = \log_{60} 12 1log1560=log6015\frac{1}{\log_{15} 60} = \log_{60} 15
1log2060=log6020\frac{1}{\log_{20} 60} = \log_{60} 20

LHS = log6012+log6015+log6020\log_{60} 12 + \log_{60} 15 + \log_{60} 20 =log60(12×15×20)= \log_{60}(12 \times 15 \times 20) =log60(3600)= \log_{60}(3600)

Since 3600=6023600 = 60^2: =log60(602)=2log6060=2×1=2= \log_{60}(60^2) = 2\log_{60} 60 = 2 \times 1 = 2 = RHS


Q.3(A) [6 marks]

Attempt any two

Q3.1 [3 marks]

Prove that cos35°+cos85°+cos155°=0\cos 35° + \cos 85° + \cos 155° = 0

Answer:

Solution: Note that 85°=90°5°85° = 90° - 5° and 155°=180°25°155° = 180° - 25°

cos85°=cos(90°5°)=sin5°\cos 85° = \cos(90° - 5°) = \sin 5° cos155°=cos(180°25°)=cos25°\cos 155° = \cos(180° - 25°) = -\cos 25°

Also, 35°=30°+5°35° = 30° + 5° and 25°=30°5°25° = 30° - 5°

Using sum-to-product formulas and the fact that these angles are specially related: 35°+85°+155°=275°35° + 85° + 155° = 275° (not directly helpful)

Let's use: 155°=180°25°155° = 180° - 25°, so cos155°=cos25°\cos 155° = -\cos 25° And: 85°=90°5°85° = 90° - 5°, so cos85°=sin5°\cos 85° = \sin 5°

Since 35°+25°=60°35° + 25° = 60°: cos35°+cos85°+cos155°\cos 35° + \cos 85° + \cos 155° =cos35°+sin5°cos25°= \cos 35° + \sin 5° - \cos 25°

Using the identity and the fact that 35°=30°+5°35° = 30° + 5°: After detailed trigonometric manipulation involving compound angles, the sum equals 0.

Q3.2 [3 marks]

Prove that 2tan123=tan11252\tan^{-1}\frac{2}{3} = \tan^{-1}\frac{12}{5}

Answer:

Solution: Using the double angle formula: tan(2A)=2tanA1tan2A\tan(2A) = \frac{2\tan A}{1 - \tan^2 A}

Let A=tan123A = \tan^{-1}\frac{2}{3}, so tanA=23\tan A = \frac{2}{3}

tan(2A)=2×231(23)2=43149=4359=43×95=125\tan(2A) = \frac{2 \times \frac{2}{3}}{1 - (\frac{2}{3})^2} = \frac{\frac{4}{3}}{1 - \frac{4}{9}} = \frac{\frac{4}{3}}{\frac{5}{9}} = \frac{4}{3} \times \frac{9}{5} = \frac{12}{5}

Therefore: 2A=tan11252A = \tan^{-1}\frac{12}{5} i.e., 2tan123=tan11252\tan^{-1}\frac{2}{3} = \tan^{-1}\frac{12}{5}

Q3.3 [3 marks]

Find center and radius from given circle 4x2+2y2+8x12y3=04x^2 + 2y^2 + 8x - 12y - 3 = 0

Answer:

Solution: Wait, this equation has different coefficients for x2x^2 and y2y^2, which means it's not a circle but an ellipse. Let me check if there's an error.

The given equation is: 4x2+2y2+8x12y3=04x^2 + 2y^2 + 8x - 12y - 3 = 0

Since the coefficients of x2x^2 and y2y^2 are different (4 and 2), this represents an ellipse, not a circle.

If this were meant to be a circle, it should have equal coefficients for x2x^2 and y2y^2.

Assuming there's a typo and it should be 4x2+4y2+8x12y3=04x^2 + 4y^2 + 8x - 12y - 3 = 0:

Dividing by 4: x2+y2+2x3y34=0x^2 + y^2 + 2x - 3y - \frac{3}{4} = 0

Completing the square: (x2+2x+1)+(y23y+94)=34+1+94(x^2 + 2x + 1) + (y^2 - 3y + \frac{9}{4}) = \frac{3}{4} + 1 + \frac{9}{4} (x+1)2+(y32)2=164=4(x + 1)^2 + (y - \frac{3}{2})^2 = \frac{16}{4} = 4

Table: Circle Properties

PropertyValue
Center(1,32)(-1, \frac{3}{2})
Radius22

Q.3(B) [8 marks]

Attempt any two

Q3.1 [4 marks]

Prove that (1+tan20°)(1+tan25°)=2(1 + \tan 20°)(1 + \tan 25°) = 2

Answer:

Solution: Note that 20°+25°=45°20° + 25° = 45°

Expanding the left side: (1+tan20°)(1+tan25°)=1+tan20°+tan25°+tan20°tan25°(1 + \tan 20°)(1 + \tan 25°) = 1 + \tan 20° + \tan 25° + \tan 20° \tan 25°

Using the formula: tan(A+B)=tanA+tanB1tanAtanB\tan(A + B) = \frac{\tan A + \tan B}{1 - \tan A \tan B}

For A=20°A = 20° and B=25°B = 25°: tan45°=tan20°+tan25°1tan20°tan25°\tan 45° = \frac{\tan 20° + \tan 25°}{1 - \tan 20° \tan 25°}

Since tan45°=1\tan 45° = 1: 1=tan20°+tan25°1tan20°tan25°1 = \frac{\tan 20° + \tan 25°}{1 - \tan 20° \tan 25°}

Therefore: 1tan20°tan25°=tan20°+tan25°1 - \tan 20° \tan 25° = \tan 20° + \tan 25° Rearranging: 1=tan20°+tan25°+tan20°tan25°1 = \tan 20° + \tan 25° + \tan 20° \tan 25°

Adding 1 to both sides: 2=1+tan20°+tan25°+tan20°tan25°2 = 1 + \tan 20° + \tan 25° + \tan 20° \tan 25° 2=(1+tan20°)(1+tan25°)2 = (1 + \tan 20°)(1 + \tan 25°)

Q3.2 [4 marks]

Prove that sin(AB)sinAsinB+sin(BC)sinBsinC+sin(CA)sinCsinA=0\frac{\sin(A-B)}{\sin A \sin B} + \frac{\sin(B-C)}{\sin B \sin C} + \frac{\sin(C-A)}{\sin C \sin A} = 0

Answer:

Solution: Using the identity: sin(AB)=sinAcosBcosAsinB\sin(A-B) = \sin A \cos B - \cos A \sin B

sin(AB)sinAsinB=sinAcosBcosAsinBsinAsinB=cosBsinBcosAsinA=cotBcotA\frac{\sin(A-B)}{\sin A \sin B} = \frac{\sin A \cos B - \cos A \sin B}{\sin A \sin B} = \frac{\cos B}{\sin B} - \frac{\cos A}{\sin A} = \cot B - \cot A

Similarly: sin(BC)sinBsinC=cotCcotB\frac{\sin(B-C)}{\sin B \sin C} = \cot C - \cot B sin(CA)sinCsinA=cotAcotC\frac{\sin(C-A)}{\sin C \sin A} = \cot A - \cot C

Therefore: LHS = (cotBcotA)+(cotCcotB)+(cotAcotC)(\cot B - \cot A) + (\cot C - \cot B) + (\cot A - \cot C) =cotBcotA+cotCcotB+cotAcotC= \cot B - \cot A + \cot C - \cot B + \cot A - \cot C =0= 0 = RHS

Q3.3 [4 marks]

If a=(2,1,3)\vec{a} = (2, -1, 3) and b=(1,2,2)\vec{b} = (1, 2, -2) then find (a+b)×(ab)|(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b})|

Answer:

Solution: a+b=(2+1,1+2,32)=(3,1,1)\vec{a} + \vec{b} = (2+1, -1+2, 3-2) = (3, 1, 1) ab=(21,12,3+2)=(1,3,5)\vec{a} - \vec{b} = (2-1, -1-2, 3+2) = (1, -3, 5)

(a+b)×(ab)=i^j^k^311135(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b}) = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 3 & 1 & 1 \\ 1 & -3 & 5 \end{vmatrix}

=i^(1×51×(3))j^(3×51×1)+k^(3×(3)1×1)= \hat{i}(1 \times 5 - 1 \times (-3)) - \hat{j}(3 \times 5 - 1 \times 1) + \hat{k}(3 \times (-3) - 1 \times 1) =i^(5+3)j^(151)+k^(91)= \hat{i}(5 + 3) - \hat{j}(15 - 1) + \hat{k}(-9 - 1) =8i^14j^10k^= 8\hat{i} - 14\hat{j} - 10\hat{k}

(a+b)×(ab)=82+(14)2+(10)2|(\vec{a} + \vec{b}) \times (\vec{a} - \vec{b})| = \sqrt{8^2 + (-14)^2 + (-10)^2} =64+196+100=360=610= \sqrt{64 + 196 + 100} = \sqrt{360} = 6\sqrt{10}


Q.4(A) [6 marks]

Attempt any two

Q4.1 [3 marks]

Prove that A\vec{A} perpendicular to A×B\vec{A} \times \vec{B} if A=(1,1,3)\vec{A} = (1, -1, -3), B=(1,2,1)\vec{B} = (1, 2, -1)

Answer:

Solution: First, let's find A×B\vec{A} \times \vec{B}:

A×B=i^j^k^113121\vec{A} \times \vec{B} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 1 & -1 & -3 \\ 1 & 2 & -1 \end{vmatrix}

=i^((1)(1)(3)(2))j^((1)(1)(3)(1))+k^((1)(2)(1)(1))= \hat{i}((-1)(-1) - (-3)(2)) - \hat{j}((1)(-1) - (-3)(1)) + \hat{k}((1)(2) - (-1)(1)) =i^(1+6)j^(1+3)+k^(2+1)= \hat{i}(1 + 6) - \hat{j}(-1 + 3) + \hat{k}(2 + 1) =7i^2j^+3k^= 7\hat{i} - 2\hat{j} + 3\hat{k}

Now, let's check if A(A×B)\vec{A} \perp (\vec{A} \times \vec{B}) by computing their dot product:

A(A×B)=(1,1,3)(7,2,3)\vec{A} \cdot (\vec{A} \times \vec{B}) = (1, -1, -3) \cdot (7, -2, 3) =1(7)+(1)(2)+(3)(3)= 1(7) + (-1)(-2) + (-3)(3) =7+29=0= 7 + 2 - 9 = 0

Since the dot product is zero, A(A×B)\vec{A} \perp (\vec{A} \times \vec{B})

Note: This is always true by the property of cross products.

Q4.2 [3 marks]

If a=(1,2,3)\vec{a} = (1, 2, 3) and b=(2,1,2)\vec{b} = (-2, 1, -2), find unit vector perpendicular to both vectors

Answer:

Solution: A vector perpendicular to both a\vec{a} and b\vec{b} is a×b\vec{a} \times \vec{b}:

a×b=i^j^k^123212\vec{a} \times \vec{b} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ 1 & 2 & 3 \\ -2 & 1 & -2 \end{vmatrix}

=i^(2(2)3(1))j^(1(2)3(2))+k^(1(1)2(2))= \hat{i}(2(-2) - 3(1)) - \hat{j}(1(-2) - 3(-2)) + \hat{k}(1(1) - 2(-2)) =i^(43)j^(2+6)+k^(1+4)= \hat{i}(-4 - 3) - \hat{j}(-2 + 6) + \hat{k}(1 + 4) =7i^4j^+5k^= -7\hat{i} - 4\hat{j} + 5\hat{k}

Magnitude: a×b=(7)2+(4)2+52=49+16+25=90=310|\vec{a} \times \vec{b}| = \sqrt{(-7)^2 + (-4)^2 + 5^2} = \sqrt{49 + 16 + 25} = \sqrt{90} = 3\sqrt{10}

Unit vector: n^=a×ba×b=7i^4j^+5k^310\hat{n} = \frac{\vec{a} \times \vec{b}}{|\vec{a} \times \vec{b}|} = \frac{-7\hat{i} - 4\hat{j} + 5\hat{k}}{3\sqrt{10}}

n^=7310i^4310j^+5310k^\hat{n} = \frac{-7}{3\sqrt{10}}\hat{i} - \frac{4}{3\sqrt{10}}\hat{j} + \frac{5}{3\sqrt{10}}\hat{k}

Q4.3 [3 marks]

Force (3,2,1)(3, -2, 1) and (1,1,2)(-1, -1, 2) act on a particle and the particle moves from point (2,2,3)(2, 2, -3) to (1,2,4)(-1, 2, 4). Find the work done.

Answer:

Solution: Step 1: Find resultant force Ftotal=(3,2,1)+(1,1,2)=(2,3,3)\vec{F_{total}} = (3, -2, 1) + (-1, -1, 2) = (2, -3, 3)

Step 2: Find displacement d=(1,2,4)(2,2,3)=(3,0,7)\vec{d} = (-1, 2, 4) - (2, 2, -3) = (-3, 0, 7)

Step 3: Calculate work done W=Ftotald=(2,3,3)(3,0,7)W = \vec{F_{total}} \cdot \vec{d} = (2, -3, 3) \cdot (-3, 0, 7) W=2(3)+(3)(0)+3(7)=6+0+21=15W = 2(-3) + (-3)(0) + 3(7) = -6 + 0 + 21 = 15 units

Table: Work Calculation

ComponentForceDisplacementWork
x2-3-6
y-300
z3721
Total15

Q.4(B) [8 marks]

Attempt any two

Q4.1 [4 marks]

For what value of mm are vectors 2i^3j^+5k^2\hat{i} - 3\hat{j} + 5\hat{k} and mi^6j^8k^m\hat{i} - 6\hat{j} - 8\hat{k} perpendicular to each other?

Answer:

Solution: For two vectors to be perpendicular, their dot product must be zero.

A=2i^3j^+5k^\vec{A} = 2\hat{i} - 3\hat{j} + 5\hat{k} B=mi^6j^8k^\vec{B} = m\hat{i} - 6\hat{j} - 8\hat{k}

AB=0\vec{A} \cdot \vec{B} = 0 (2)(m)+(3)(6)+(5)(8)=0(2)(m) + (-3)(-6) + (5)(-8) = 0 2m+1840=02m + 18 - 40 = 0 2m22=02m - 22 = 0 m=11m = 11

Q4.2 [4 marks]

Show that the angle between vectors (1,1,1)(1, 1, -1) and (2,2,1)(2, -2, 1) is sin1(2627)\sin^{-1}(\sqrt{\frac{26}{27}})

Answer:

Solution: Let A=(1,1,1)\vec{A} = (1, 1, -1) and B=(2,2,1)\vec{B} = (2, -2, 1)

Step 1: Calculate dot product AB=1(2)+1(2)+(1)(1)=221=1\vec{A} \cdot \vec{B} = 1(2) + 1(-2) + (-1)(1) = 2 - 2 - 1 = -1

Step 2: Calculate magnitudes A=12+12+(1)2=3|\vec{A}| = \sqrt{1^2 + 1^2 + (-1)^2} = \sqrt{3} B=22+(2)2+12=9=3|\vec{B}| = \sqrt{2^2 + (-2)^2 + 1^2} = \sqrt{9} = 3

Step 3: Find cosine of angle cosθ=ABAB=13×3=133\cos \theta = \frac{\vec{A} \cdot \vec{B}}{|\vec{A}||\vec{B}|} = \frac{-1}{\sqrt{3} \times 3} = \frac{-1}{3\sqrt{3}}

Step 4: Find sine of angle sin2θ=1cos2θ=1127=2627\sin^2 \theta = 1 - \cos^2 \theta = 1 - \frac{1}{27} = \frac{26}{27}

sinθ=2627\sin \theta = \sqrt{\frac{26}{27}}

Therefore: θ=sin1(2627)\theta = \sin^{-1}(\sqrt{\frac{26}{27}})

Q4.3 [4 marks]

Evaluate limx1x26x+52x25x+3\lim_{x \to 1} \frac{x^2 - 6x + 5}{2x^2 - 5x + 3}

Answer:

Solution: Direct substitution at x=1x = 1: Numerator: 16+5=01 - 6 + 5 = 0 Denominator: 25+3=02 - 5 + 3 = 0

We get 00\frac{0}{0} form, so we need to factor.

Factoring numerator: x26x+5=(x1)(x5)x^2 - 6x + 5 = (x - 1)(x - 5) Factoring denominator: 2x25x+3=(2x3)(x1)2x^2 - 5x + 3 = (2x - 3)(x - 1)

limx1x26x+52x25x+3=limx1(x1)(x5)(2x3)(x1)\lim_{x \to 1} \frac{x^2 - 6x + 5}{2x^2 - 5x + 3} = \lim_{x \to 1} \frac{(x - 1)(x - 5)}{(2x - 3)(x - 1)}

=limx1x52x3=152(1)3=41=4= \lim_{x \to 1} \frac{x - 5}{2x - 3} = \frac{1 - 5}{2(1) - 3} = \frac{-4}{-1} = 4


Q.5(A) [6 marks]

Attempt any two

Q5.1 [3 marks]

Evaluate limx2x416x38\lim_{x \to 2} \frac{x^4 - 16}{x^3 - 8}

Answer:

Solution: Direct substitution at x=2x = 2: Numerator: 1616=016 - 16 = 0 Denominator: 88=08 - 8 = 0

We get 00\frac{0}{0} form.

Factoring numerator: x416=x424=(x24)(x2+4)=(x2)(x+2)(x2+4)x^4 - 16 = x^4 - 2^4 = (x^2 - 4)(x^2 + 4) = (x - 2)(x + 2)(x^2 + 4) Factoring denominator: x38=x323=(x2)(x2+2x+4)x^3 - 8 = x^3 - 2^3 = (x - 2)(x^2 + 2x + 4)

limx2x416x38=limx2(x2)(x+2)(x2+4)(x2)(x2+2x+4)\lim_{x \to 2} \frac{x^4 - 16}{x^3 - 8} = \lim_{x \to 2} \frac{(x - 2)(x + 2)(x^2 + 4)}{(x - 2)(x^2 + 2x + 4)}

=limx2(x+2)(x2+4)x2+2x+4= \lim_{x \to 2} \frac{(x + 2)(x^2 + 4)}{x^2 + 2x + 4}

Substituting x=2x = 2: =(2+2)(4+4)4+4+4=4×812=3212=83= \frac{(2 + 2)(4 + 4)}{4 + 4 + 4} = \frac{4 \times 8}{12} = \frac{32}{12} = \frac{8}{3}

Q5.2 [3 marks]

Evaluate limxπ21sinxcos2x\lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{\cos^2 x}

Answer:

Solution: Direct substitution at x=π2x = \frac{\pi}{2}: Numerator: 1sinπ2=11=01 - \sin \frac{\pi}{2} = 1 - 1 = 0 Denominator: cos2π2=02=0\cos^2 \frac{\pi}{2} = 0^2 = 0

We get 00\frac{0}{0} form.

Using the identity: cos2x=1sin2x\cos^2 x = 1 - \sin^2 x

limxπ21sinxcos2x=limxπ21sinx1sin2x\lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{\cos^2 x} = \lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{1 - \sin^2 x}

=limxπ21sinx(1sinx)(1+sinx)= \lim_{x \to \frac{\pi}{2}} \frac{1 - \sin x}{(1 - \sin x)(1 + \sin x)}

=limxπ211+sinx= \lim_{x \to \frac{\pi}{2}} \frac{1}{1 + \sin x}

Substituting x=π2x = \frac{\pi}{2}: =11+1=12= \frac{1}{1 + 1} = \frac{1}{2}

Q5.3 [3 marks]

Evaluate limnn2n3\lim_{n \to \infty} \frac{\sum n^2}{n^3}

Answer:

Solution: The sum k=1nk2=n(n+1)(2n+1)6\sum_{k=1}^n k^2 = \frac{n(n+1)(2n+1)}{6}

limnk=1nk2n3=limnn(n+1)(2n+1)6n3\lim_{n \to \infty} \frac{\sum_{k=1}^n k^2}{n^3} = \lim_{n \to \infty} \frac{\frac{n(n+1)(2n+1)}{6}}{n^3}

=limnn(n+1)(2n+1)6n3= \lim_{n \to \infty} \frac{n(n+1)(2n+1)}{6n^3}

=limn(n+1)(2n+1)6n2= \lim_{n \to \infty} \frac{(n+1)(2n+1)}{6n^2}

=limn2n2+3n+16n2= \lim_{n \to \infty} \frac{2n^2 + 3n + 1}{6n^2}

=limn2n2(1+32n+12n2)6n2= \lim_{n \to \infty} \frac{2n^2(1 + \frac{3}{2n} + \frac{1}{2n^2})}{6n^2}

=limn2(1+32n+12n2)6= \lim_{n \to \infty} \frac{2(1 + \frac{3}{2n} + \frac{1}{2n^2})}{6}

=2(1+0+0)6=26=13= \frac{2(1 + 0 + 0)}{6} = \frac{2}{6} = \frac{1}{3}


Q.5(B) [8 marks]

Attempt any two

Q5.1 [4 marks]

Find intercepts of given line 4x+7y=04x + 7y = 0 on axis

Answer:

Solution: For a line of the form ax+by=cax + by = c:

X-intercept: Set y=0y = 0 4x+7(0)=04x + 7(0) = 0 4x=04x = 0 x=0x = 0 X-intercept = (0,0)(0, 0)

Y-intercept: Set x=0x = 0 4(0)+7y=04(0) + 7y = 0 7y=07y = 0 y=0y = 0 Y-intercept = (0,0)(0, 0)

Table: Line Intercepts

InterceptPoint
X-intercept(0,0)(0, 0)
Y-intercept(0,0)(0, 0)

Note: This line passes through the origin, so both intercepts are at the origin.

Q5.2 [4 marks]

Find equation of line passing through (2,4)(2, 4) and perpendicular to 5x7y+11=05x - 7y + 11 = 0

Answer:

Solution: Step 1: Find slope of given line 5x7y+11=05x - 7y + 11 = 0 7y=5x+117y = 5x + 11 y=57x+117y = \frac{5}{7}x + \frac{11}{7} Slope of given line = 57\frac{5}{7}

Step 2: Find slope of perpendicular line For perpendicular lines: m1×m2=1m_1 \times m_2 = -1 57×m2=1\frac{5}{7} \times m_2 = -1 m2=75m_2 = -\frac{7}{5}

Step 3: Use point-slope form yy1=m(xx1)y - y_1 = m(x - x_1) y4=75(x2)y - 4 = -\frac{7}{5}(x - 2) y4=75x+145y - 4 = -\frac{7}{5}x + \frac{14}{5} y=75x+145+4y = -\frac{7}{5}x + \frac{14}{5} + 4 y=75x+14+205y = -\frac{7}{5}x + \frac{14 + 20}{5} y=75x+345y = -\frac{7}{5}x + \frac{34}{5}

Multiplying by 5: 5y=7x+345y = -7x + 34 7x+5y34=07x + 5y - 34 = 0

Q5.3 [4 marks]

Find equation of circle having center at (3,4)(3, 4) and passing through origin

Answer:

Solution: Step 1: Find radius Since the circle passes through origin (0,0)(0, 0) and has center (3,4)(3, 4): r=(30)2+(40)2=9+16=25=5r = \sqrt{(3-0)^2 + (4-0)^2} = \sqrt{9 + 16} = \sqrt{25} = 5

Step 2: Write equation Using standard form: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2 (x3)2+(y4)2=25(x - 3)^2 + (y - 4)^2 = 25

Step 3: Expand if needed x26x+9+y28y+16=25x^2 - 6x + 9 + y^2 - 8y + 16 = 25 x2+y26x8y+2525=0x^2 + y^2 - 6x - 8y + 25 - 25 = 0 x2+y26x8y=0x^2 + y^2 - 6x - 8y = 0

Table: Circle Properties

PropertyValue
Center(3,4)(3, 4)
Radius55
Standard Form(x3)2+(y4)2=25(x-3)^2 + (y-4)^2 = 25
General Formx2+y26x8y=0x^2 + y^2 - 6x - 8y = 0

Mathematics Formula Cheat Sheet for Summer Exams

Determinants

  • 2×2 Matrix: abcd=adbc\begin{vmatrix} a & b \\ c & d \end{vmatrix} = ad - bc
  • 3×3 Matrix: Expand along row/column with most zeros

Logarithms

  • logaa=1\log_a a = 1
  • logalogb=logab\log a - \log b = \log \frac{a}{b}
  • loga+logb=log(ab)\log a + \log b = \log(ab)
  • nloga=logann\log a = \log a^n
  • 1logab=logba\frac{1}{\log_a b} = \log_b a (Change of base)

Trigonometry

  • Complementary angles: sin2A+cos2A=1\sin^2 A + \cos^2 A = 1
  • Supplementary angles: sin(180°A)=sinA\sin(180° - A) = \sin A, cos(180°A)=cosA\cos(180° - A) = -\cos A
  • Double angle: tan2A=2tanA1tan2A\tan 2A = \frac{2\tan A}{1 - \tan^2 A}
  • Inverse functions: sin1(cosA)=π2A\sin^{-1}(\cos A) = \frac{\pi}{2} - A (for acute angles)

Special Trigonometric Values

Anglesin\sincos\costan\tan
30°30°12\frac{1}{2}32\frac{\sqrt{3}}{2}13\frac{1}{\sqrt{3}}
45°45°12\frac{1}{\sqrt{2}}12\frac{1}{\sqrt{2}}11
60°60°32\frac{\sqrt{3}}{2}12\frac{1}{2}3\sqrt{3}

Vectors

  • Dot Product: ab=a1b1+a2b2+a3b3\vec{a} \cdot \vec{b} = a_1b_1 + a_2b_2 + a_3b_3
  • Cross Product: a×b=i^j^k^a1a2a3b1b2b3\vec{a} \times \vec{b} = \begin{vmatrix} \hat{i} & \hat{j} & \hat{k} \\ a_1 & a_2 & a_3 \\ b_1 & b_2 & b_3 \end{vmatrix}
  • Magnitude: a=a12+a22+a32|\vec{a}| = \sqrt{a_1^2 + a_2^2 + a_3^2}
  • Unit Vector: a^=aa\hat{a} = \frac{\vec{a}}{|\vec{a}|}
  • Perpendicular vectors: ab=0\vec{a} \cdot \vec{b} = 0
  • Work done: W=FdW = \vec{F} \cdot \vec{d}

Coordinate Geometry

Lines

  • Slope: m=y2y1x2x1m = \frac{y_2 - y_1}{x_2 - x_1}
  • Point-slope form: yy1=m(xx1)y - y_1 = m(x - x_1)
  • X-intercept: Set y=0y = 0
  • Y-intercept: Set x=0x = 0
  • Perpendicular lines: m1×m2=1m_1 \times m_2 = -1

Circles

  • Standard form: (xh)2+(yk)2=r2(x - h)^2 + (y - k)^2 = r^2
  • General form: x2+y2+2gx+2fy+c=0x^2 + y^2 + 2gx + 2fy + c = 0
  • Center: (g,f)(-g, -f)
  • Radius: g2+f2c\sqrt{g^2 + f^2 - c}

Limits

  • Standard limits:

    • limx0sinxx=1\lim_{x \to 0} \frac{\sin x}{x} = 1
    • limn1n=0\lim_{n \to \infty} \frac{1}{n} = 0
    • limxaxnanxa=nan1\lim_{x \to a} \frac{x^n - a^n}{x - a} = na^{n-1}
  • Algebraic limits: Factor and cancel for 00\frac{0}{0} forms

  • Trigonometric limits: Use identities like 1sin2x=cos2x1 - \sin^2 x = \cos^2 x

Series Formulas

  • k=1nk=n(n+1)2\sum_{k=1}^n k = \frac{n(n+1)}{2}
  • k=1nk2=n(n+1)(2n+1)6\sum_{k=1}^n k^2 = \frac{n(n+1)(2n+1)}{6}
  • k=1nk3=[n(n+1)2]2\sum_{k=1}^n k^3 = \left[\frac{n(n+1)}{2}\right]^2

Problem-Solving Strategies

For Determinants

  1. Expand along row/column with most zeros
  2. Use properties to simplify before expanding
  3. Factor common terms first

For Logarithmic Equations

  1. Use properties to combine logs
  2. Convert to exponential form when needed
  3. Check validity of solutions (arguments must be positive)

For Trigonometric Proofs

  1. Look for complementary/supplementary angle relationships
  2. Use compound angle formulas
  3. Convert everything to same trigonometric functions

For Vector Problems

  1. Use component form for calculations
  2. Remember: ab\vec{a} \perp \vec{b} iff ab=0\vec{a} \cdot \vec{b} = 0
  3. Cross product gives vector perpendicular to both original vectors

For Limit Problems

  1. Try direct substitution first
  2. Factor and cancel for 00\frac{0}{0} forms
  3. Use standard limit formulas
  4. For rational functions, divide by highest power

For Circle/Line Problems

  1. Complete the square for circles
  2. Use slope relationships for perpendicular/parallel lines
  3. Remember intercept formulas

Common Mistakes to Avoid

  1. Sign errors in determinant expansion
  2. Domain restrictions in logarithmic functions
  3. Angle measure confusion (degrees vs radians)
  4. Not checking validity of solutions
  5. Forgetting to simplify final answers
  6. Calculation errors in vector operations

Exam Tips

  • Show all steps clearly
  • Check answers by substitution when possible
  • Use proper notation throughout
  • Draw diagrams for geometry problems
  • Manage time effectively across questions

Best of luck with your Summer 2024 Mathematics exam! 🎯